tris(2-(2-methoxyethoxy)ethyl)amine
{{Chembox
| ImageFile = TDA1, ptc catalyst.svg
| ImageSize = 160px
| ImageAlt =
| IUPACName =
| OtherNames = TDA-1, Tris(3,6-dioxaheptyl)amine
|Section1={{Chembox Identifiers
| CASNo = 70384-51-9
| ChemSpiderID = 100755
| EC_number = 274-590-5
| PubChem = 112414
| StdInChI=1S/C15H33NO6/c1-17-10-13-20-7-4-16(5-8-21-14-11-18-2)6-9-22-15-12-19-3/h4-15H2,1-3H3
| StdInChIKey = XGLVDUUYFKXKPL-UHFFFAOYSA-N
| SMILES = COCCOCCN(CCOCCOC)CCOCCOC
}}
|Section2={{Chembox Properties
| C = 15|N=1|H=33|O=6
| MolarMass =
| Appearance = colorless oily liquid
| Density =
| MeltingPt =
| MeltingPt_notes =
| BoilingPtC = 171
| BoilingPt_notes =
| Solubility = }}
|Section3={{Chembox Hazards
| GHS_ref=[https://pubchem.ncbi.nlm.nih.gov/compound/112414#section=Safety-and-Hazards]
| GHSPictograms = {{GHS05}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|314|318}}
| PPhrases = {{P-phrases|260|264|264+265|280|301+330+331|302+361+354|304+340|305+354+338|316|317|321|363|405|501}}
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Tris(2-(2-methoxyethoxy)ethyl)amine is the organic compound with the formula {{chem2|N(CH2CH2OCH2CH2OCH3)3}}. It is an amine and a polyether. Although samples can appear yellow, the compound is colorless.
Tris(2-(2-methoxyethoxy)ethyl)amine used in phase transfer catalysis (PTC).Marc Halpern "Phase-Transfer Catalysis" in Ullmann's Encyclopedia of Industrial Chemistry 2002, Wiley-VCH, Weinheim. {{doi|10.1002/14356007.a19_293}} For PTC, it has been described as superior to 18-crown-6.{{cite journal |doi=10.1016/S0040-4039(00)95452-2 |title=Tris(3,6-dioxaheptyl)amine: A Superior Complexing Agent for Dissolving Metal Reactions |date=1987 |last1=Bose |first1=Ajay K. |last2=Mangiaracina |first2=Pietro |journal=Tetrahedron Letters |volume=28 |issue=22 |pages=2503–2506 }}