trofosfamide

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 409083684

| IUPAC_name = N,N,3-tris(2-chloroethyl)-1,3,2-oxazaphosphinan-2-amide 2-oxide

| image = Trofosfamide.svg

| alt = Skeletal formula of trofosfamide

| width = 130

| image2 = Trofosfamide-3D-balls.png

| alt2 = Ball-and-stick model of the trofosfamide molecule

| width2 = 150

| tradename = Ixoten

| Drugs.com = {{drugs.com|international|trofosfamide}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_DE = Rx-only

| legal_status =

| routes_of_administration = By mouth (film-coated tablets)

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 22089-22-1

| ATC_prefix = L01

| ATC_suffix = AA07

| ATC_supplemental =

| PubChem = 65702

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = H64JRU6GJ0

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07252

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 462019

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 59129

| chemical_formula =

| C=9 | H=18 | Cl=3 | N=2 | O=2 | P=1

| smiles = C1CN(P(=O)(OC1)N(CCCl)CCCl)CCCl

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C9H18Cl3N2O2P/c10-2-6-13-5-1-9-16-17(13,15)14(7-3-11)8-4-12/h1-9H2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = UMKFEPPTGMDVMI-UHFFFAOYSA-N

}}

Trofosfamide (INN) is a nitrogen mustard alkylating agent. It is sometimes abbreviated "TRO".{{cite journal |vauthors=Jahnke K, Thiel E, Bechrakis NE, etal |title=Ifosfamide or trofosfamide in patients with intraocular lymphoma |journal=J. Neurooncol. |volume= 93|issue= 2|pages= 213–7|date=December 2008 |pmid=19099202 |doi=10.1007/s11060-008-9761-8|s2cid=33892177 }} It has been used in trials to study its effects on ependymoma, medulloblastoma, sarcoma, soft tissue,{{clarify|date=August 2021}} supratentorial PNET, and recurrent brain tumors.{{Cite web|url=https://www.drugbank.ca/drugs/DB12902|title=Trofosfamide|website=www.drugbank.ca|access-date=2019-12-19}}

References