trofosfamide
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 409083684
| IUPAC_name = N,N,3-tris(2-chloroethyl)-1,3,2-oxazaphosphinan-2-amide 2-oxide
| image = Trofosfamide.svg
| alt = Skeletal formula of trofosfamide
| width = 130
| image2 = Trofosfamide-3D-balls.png
| alt2 = Ball-and-stick model of the trofosfamide molecule
| width2 = 150
| tradename = Ixoten
| Drugs.com = {{drugs.com|international|trofosfamide}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_DE = Rx-only
| legal_status =
| routes_of_administration = By mouth (film-coated tablets)
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 22089-22-1
| ATC_prefix = L01
| ATC_suffix = AA07
| ATC_supplemental =
| PubChem = 65702
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = H64JRU6GJ0
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07252
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 462019
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 59129
| chemical_formula =
| C=9 | H=18 | Cl=3 | N=2 | O=2 | P=1
| smiles = C1CN(P(=O)(OC1)N(CCCl)CCCl)CCCl
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C9H18Cl3N2O2P/c10-2-6-13-5-1-9-16-17(13,15)14(7-3-11)8-4-12/h1-9H2
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = UMKFEPPTGMDVMI-UHFFFAOYSA-N
}}
Trofosfamide (INN) is a nitrogen mustard alkylating agent. It is sometimes abbreviated "TRO".{{cite journal |vauthors=Jahnke K, Thiel E, Bechrakis NE, etal |title=Ifosfamide or trofosfamide in patients with intraocular lymphoma |journal=J. Neurooncol. |volume= 93|issue= 2|pages= 213–7|date=December 2008 |pmid=19099202 |doi=10.1007/s11060-008-9761-8|s2cid=33892177 }} It has been used in trials to study its effects on ependymoma, medulloblastoma, sarcoma, soft tissue,{{clarify|date=August 2021}} supratentorial PNET, and recurrent brain tumors.{{Cite web|url=https://www.drugbank.ca/drugs/DB12902|title=Trofosfamide|website=www.drugbank.ca|access-date=2019-12-19}}