trolnitrate
{{chembox
| Verifiedfields = changed
| verifiedrevid = 470617841
| ImageFile=Trolnitrate.png
| IUPACName=2-[bis(2-nitrooxyethyl)amino]ethyl nitrate
| OtherNames=
|Section1={{Chembox Identifiers
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = B9M85U075P
| CASNo_Ref = {{cascite|changed|??}}
| CASNo=7077-34-1
| PubChem=11499
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 11015
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C6H12N4O9/c11-8(12)17-4-1-7(2-5-18-9(13)14)3-6-19-10(15)16/h1-6H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HWKQNAWCHQMZHK-UHFFFAOYSA-N
| SMILES=C(CO[N+](=O)[O-])N(CCO[N+](=O)[O-])CCO[N+](=O)[O-]
}}
|Section2={{Chembox Properties
| Formula=C6H12N4O9
| MolarMass=284.18 g/mol
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = C01
| ATCCode_suffix = DA09
}}
|Section7={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Trolnitrate (triethanolamine trinitrate, commonly used in the form of biphosphate salt also known as metamine) is an organic nitrate with vasodilator activity that is used to prevent or ameliorate attacks of angina pectoris.{{Cite web|url=https://www.merriam-webster.com/medical/trolnitrate|title=Medical Definition of TROLNITRATE}} Trolnitrate dilates the coronary vessels because of its basic action as a smooth muscle depressant, just as do nitroglycerin and other organic nitrates.{{Cite web|url=https://drugs.ncats.io/drug/B9M85U075P|title = NCATS Inxight Drugs — TROLNITRATE}}
References
{{Reflist}}
{{Vasodilators used in cardiac diseases}}
{{Nitric oxide signaling}}
{{cardiovascular-drug-stub}}