tulipanin
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 438715437
| Name = Tulipanin
| ImageFile = Tulipanin.svg
| ImageSize = 300px
| IUPACName = 3′,4′,5,5′,7-Pentahydroxy-3-[α-L-rhamnopyranosyl-(1→6)-β-D-glucopyranosyloxy]flavylium
| SystematicName = (42S,43R,44S,45S,46R,72R,73R,74R,75R,76S)-13,14,15,25,27,43,44,45,73,74,75-Undecahydroxy-76-methyl-21λ4-3,6-dioxa-2(2,3)-[1]benzopyrana-4(2,6),7(2)-bis(oxana)-1(1)-benzenaheptaphan-21-ylium
| OtherNames = Delphinidin-3-rutinoside
Delphinidin 3-O-rutinoside
Delphinidin-3-glucorhamnoside
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 58285-26-0
| CASNoOther =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 6I4SV29842
| KEGG = C16315
| PubChem = 5492231
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 4590910
| SMILES = O(C[C@H]4O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2c1cc(O)c(O)c(O)c1)[C@H](O)[C@@H](O)[C@@H]4O)[C@@H]5O[C@H]([C@H](O)[C@@H](O)[C@H]5O)C
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C27H30O16/c1-8-18(32)21(35)23(37)26(40-8)39-7-17-20(34)22(36)24(38)27(43-17)42-16-6-11-12(29)4-10(28)5-15(11)41-25(16)9-2-13(30)19(33)14(31)3-9/h2-6,8,17-18,20-24,26-27,32,34-38H,7H2,1H3,(H4-,28,29,30,31,33)/p+1/t8-,17+,18-,20+,21+,22-,23+,24+,26+,27+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = PLKUTZNSKRWCCA-LTSKFBHWSA-O
}}
|Section2={{Chembox Properties
| Formula = C27H31ClO16
C27H31O16+
| MolarMass = 611.52 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Tulipanin is an anthocyanin. It is the 3-O-rutinoside of delphinidin. It can be found in Alstroemeria spp., Berberis spp., Cissus sicyoides, Hymenocallis spp., Manihot utilissima, Meliosma tenuis, Musa acuminata, Ophiopogon japonicus, Petunia exserta, Petunia reitzii, blackcurrant (Ribes nigrum), Schismatoglottis concinna, Secale cereale, Solanum betaceum, Thaumatococcus daniellii, Tulipa sppHarborne, The Handbook of Natural Flavonoids, 2, (1999), 1, Anthocyanins[http://kanaya.naist.jp/knapsack_jsp/information.jsp?word=C00006708 Tulipanin on kanaya.naist.jp] and in eggplants.Structures and Antioxidant Activity of Anthocyanins in Many Accessions of Eggplant and Its Related Species. Keiko Azuma, Akio Ohyama, Katsunari Ippoushi, Takashi Ichiyanagi, Atsuko Takeuchi, Takeo Saito and Hiroyuki Fukuoka, J. Agric. Food Chem., 2008, 56 (21), pp 10154–10159, {{doi|10.1021/jf801322m}}