upamostat
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = ethyl 4-[(2S)-3-[3-[(E)-N'-
| image = Upamostat_structure.png
| tradename =
| legal_US =
| legal_status = Investigational new drug
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 1191101-18-4
| PubChem = 9852201
| UNII = S5M7KW6U17
| ChemSpiderID = 28189283
| DrugBank = DB13052
| CAS_number_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| C=32 | H=47 | N=5 | O=6 | S=1
| SMILES = CCOC(=O)N1CCN(CC1)C(=O)[C@H](CC2=CC(=CC=C2)/C(=N\O)/N)NS(=O)(=O)C3=C(C=C(C=C3C(C)C)C(C)C)C(C)C
| StdInChI=1S/C32H47N5O6S/c1-8-43-32(39)37-14-12-36(13-15-37)31(38)28(17-23-10-9-11-24(16-23)30(33)34-40)35-44(41,42)29-26(21(4)5)18-25(20(2)3)19-27(29)22(6)7/h9-11,16,18-22,28,35,40H,8,12-15,17H2,1-7H3,(H2,33,34)/t28-/m0/s1
| StdInChIKey = HUASEDVYRABWCV-NDEPHWFRSA-N
}}
Upamostat (WX-671, Mesupron) is a drug which acts as an inhibitor of the serine protease enzyme urokinase. It is under development as a potential treatment agent for pancreatic cancer, acting to inhibit tumour metastasis.{{cite journal | vauthors = Kuş C, Özer E, Korkmaz Y, Yurtcu E, Dağalp R | title = Benzamide and Benzamidine Compounds as New Inhibitors of Urokinasetype Plasminogen Activators | journal = Mini Reviews in Medicinal Chemistry | year = 2018 | volume = 18 | issue = 20 | pages = 1753–1758 | pmid = 30112993 | doi = 10.2174/1389557518666180816110740 | s2cid = 52011447 }}{{cite journal | vauthors = Heinemann V, Ebert MP, Laubender RP, Bevan P, Mala C, Boeck S | title = Phase II randomised proof-of-concept study of the urokinase inhibitor upamostat (WX-671) in combination with gemcitabine compared with gemcitabine alone in patients with non-resectable, locally advanced pancreatic cancer | journal = British Journal of Cancer | volume = 108 | issue = 4 | pages = 766–70 | date = March 2013 | pmid = 23412098 | doi = 10.1038/bjc.2013.62 | pmc = 3590684 }}{{cite journal | vauthors = Froriep D, Clement B, Bittner F, Mendel RR, Reichmann D, Schmalix W, Havemeyer A | title = Activation of the anti-cancer agent upamostat by the mARC enzyme system | journal = Xenobiotica; the Fate of Foreign Compounds in Biological Systems | volume = 43 | issue = 9 | pages = 780–4 | date = September 2013 | pmid = 23379481 | doi = 10.3109/00498254.2013.767481 | s2cid = 20052617 }}