uridine diphosphate glucose
{{chembox
| verifiedrevid = 470620377
| ImageFile = UDP-Glucose.svg
| ImageSize =
| IUPACName = Uridine 5′-(α-D-glucopyranosyl dihydrogen diphosphate)
| SystematicName = O1-
| OtherNames = UDP-glucose
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8308
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 375951
| InChI = 1/C15H24N2O17P2/c18-3-5-8(20)10(22)12(24)14(32-5)33-36(28,29)34-35(26,27)30-4-6-9(21)11(23)13(31-6)17-2-1-7(19)16-15(17)25/h1-2,5-6,8-14,18,20-24H,3-4H2,(H,26,27)(H,28,29)(H,16,19,25)/t5-,6-,8-,9-,10+,11-,12-,13-,14-/m1/s1
| InChIKey = HSCJRCZFDFQWRP-JZMIEXBBBU
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C15H24N2O17P2/c18-3-5-8(20)10(22)12(24)14(32-5)33-36(28,29)34-35(26,27)30-4-6-9(21)11(23)13(31-6)17-2-1-7(19)16-15(17)25/h1-2,5-6,8-14,18,20-24H,3-4H2,(H,26,27)(H,28,29)(H,16,19,25)/t5-,6-,8-,9-,10+,11-,12-,13-,14-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HSCJRCZFDFQWRP-JZMIEXBBSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 133-89-1
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = V50K1D7P4Y
| PubChem = 8629
| IUPHAR_ligand = 1783
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 52249
| SMILES = O=P(O[C@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)(O)OP(=O)(O)OC[C@H]3O[C@@H](N2/C=C\C(=O)NC2=O)[C@H](O)[C@@H]3O
| MeSHName = Uridine+Diphosphate+Glucose
}}
| Section2 = {{Chembox Properties
| Formula = C15H24N2O17P2
| MolarMass = 566.302 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Uridine diphosphate glucose (uracil-diphosphate glucose, UDP-glucose) is a nucleotide sugar. It is involved in glycosyltransferase reactions in metabolism.
Functions
UDP-glucose is used in nucleotide sugar metabolism as an activated form of glucose, a substrate for enzymes called glucosyltransferases.{{cite journal |vauthors=Rademacher T, Parekh R, Dwek R |title=Glycobiology |journal=Annu Rev Biochem |volume=57 |pages=785–838 |year=1988 |pmid=3052290 |doi=10.1146/annurev.bi.57.070188.004033}}
UDP-glucose is a precursor of glycogen and can be converted into UDP-galactose and UDP-glucuronic acid, which can then be used as substrates by the enzymes that make polysaccharides containing galactose and glucuronic acid.
UDP-glucose can also be used as a precursor of sucrose, lipopolysaccharides and glycosphingolipids.
Components
UDP-glucose consists of the pyrophosphate group, ribose, glucose, and uracil.
See also
References
{{reflist}}
{{Nucleotide sugars}}
{{Fructose and galactose metabolic intermediates}}
{{Purinergics}}