valoneic acid dilactone

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 442936423

| Name = Valoneic acid dilactone

| ImageFile = Valoneic acid dilactone.svg

| ImageSize = 250px

| ImageName = Chemical structure of valoneic acid dilactone

| ImageAlt = Chemical structure of valoneic acid dilactone

| PIN = 3,4,5-Trihydroxy-2-[(3,7,8-trihydroxy-5,10-dioxo-5,10-dihydro[1]benzopyrano[5,4,3-cde][1]benzopyran-2-yl)oxy]benzoate

| OtherNames = Valoneic acid bislactone
Valoneic acid bilactone

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 60202-70-2

| CASNoOther =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = UH5C3DT5LR

| SMILES = Oc1cc5c(=O)oc3c(O)c(Oc4c(C(=O)O)cc(O)c(O)c4O)cc2c3c5c(c1O)oc2=O

| PubChem = 10151874

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 8327382

| InChI = 1/C21H10O13/c22-7-2-6(19(28)29)16(15(27)12(7)24)32-9-3-5-11-10-4(20(30)34-18(11)14(9)26)1-8(23)13(25)17(10)33-21(5)31/h1-3,22-27H,(H,28,29)

| InChIKey = BPAOAXAAABIQKR-UHFFFAOYAM

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C21H10O13/c22-7-2-6(19(28)29)16(15(27)12(7)24)32-9-3-5-11-10-4(20(30)34-18(11)14(9)26)1-8(23)13(25)17(10)33-21(5)31/h1-3,22-27H,(H,28,29)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = BPAOAXAAABIQKR-UHFFFAOYSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| Formula = C₂₁H₁₀O₁₃

| MolarMass = 470.28 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| GHS_ref =

| FlashPt =

| AutoignitionPt =

}}

}}

Valoneic acid dilactone is a hydrolysable tannin that can be isolated from the heartwood of Shorea laevifolia5A-Reductase inhibitory tannin-related compounds isolated from Shorea laevifolia. Yoshio Hirano, Ryuichiro Kondo and Kokki Sakai, Journal of wood science, Volume 49, Number 4, pp.339-343,{{doi|10.1007/s10086-002-0481-y}} and in oaks species like the North American white oak (Quercus alba) and European red oak (Quercus robur).Analysis of oak tannins by liquid chromatography-electrospray ionisation mass spectrometry. Pirjo Mämmelä, Heikki Savolainenb, Lasse Lindroosa, Juhani Kangasd and Terttu Vartiainen, Journal of Chromatography A, Volume 891, Issue 1, 1 September 2000, Pages 75-83, {{doi|10.1016/S0021-9673(00)00624-5}}

It shows an inhibitory effect on 5α-reductase, an enzyme involved in steroids metabolism and prostate cancer.