valproate pivoxil
{{short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 477003027
| IUPAC_name = [(2,2-dimethylpropanoyl)oxy]methyl 2-propylpentanoate
| image = Valproate_pivoxil.png
| tradename =
| pregnancy_category =
| legal_status = Rx-only
| routes_of_administration = Oral
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 77372-61-3
| ATC_prefix = none
| ATC_suffix =
| PubChem = 71160
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 64301
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 9F5A05A29T
| C=14 | H=26 | O=4
| smiles = O=C(OCOC(=O)C(C)(C)C)C(CCC)CCC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H26O4/c1-6-8-11(9-7-2)12(15)17-10-18-13(16)14(3,4)5/h11H,6-10H2,1-5H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = DJEFRLDEQKSNLM-UHFFFAOYSA-N
}}
Valproate pivoxil (Pivadin, Valproxen) is an anticonvulsant used in the treatment of epilepsy.{{cite book | vauthors = Triggle DJ | title = Dictionary of pharmacological agents | publisher = Chapman & Hall | location = London | year = 1997 | isbn = 0-412-46630-9 | url = https://books.google.com/books?id=A0THacd46ZsC&q=%22valproate%20pivoxil%22&pg=PA1685}} It is the pivaloyloxymethyl ester derivative of valproic acid.{{cite book | vauthors = Hall JA, Morton IK | title = Concise dictionary of pharmacological agents: properties and synonyms | publisher = Kluwer Academic | year = 1999 | pages = 342 | isbn = 0-7514-0499-3 | url = https://books.google.com/books?id=mqaOMOtk61IC&q=%22valproate+pivoxil%22&pg=PA287}} It is likely a prodrug of valproic acid, as pivoxil esters are commonly employed to make prodrugs in medicinal chemistry.
See also
References
{{Reflist}}
{{Anticonvulsants}}
{{Mood stabilizers}}
{{GABA metabolism and transport modulators}}
{{HDAC inhibitors}}
{{Ion channel modulators}}
Category:GABA transaminase inhibitors
Category:Histone deacetylase inhibitors
{{anticonvulsant-stub}}