valproate pivoxil

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 477003027

| IUPAC_name = [(2,2-dimethylpropanoyl)oxy]methyl 2-propylpentanoate

| image = Valproate_pivoxil.png

| tradename =

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 77372-61-3

| ATC_prefix = none

| ATC_suffix =

| PubChem = 71160

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 64301

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 9F5A05A29T

| C=14 | H=26 | O=4

| smiles = O=C(OCOC(=O)C(C)(C)C)C(CCC)CCC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H26O4/c1-6-8-11(9-7-2)12(15)17-10-18-13(16)14(3,4)5/h11H,6-10H2,1-5H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = DJEFRLDEQKSNLM-UHFFFAOYSA-N

}}

Valproate pivoxil (Pivadin, Valproxen) is an anticonvulsant used in the treatment of epilepsy.{{cite book | vauthors = Triggle DJ | title = Dictionary of pharmacological agents | publisher = Chapman & Hall | location = London | year = 1997 | isbn = 0-412-46630-9 | url = https://books.google.com/books?id=A0THacd46ZsC&q=%22valproate%20pivoxil%22&pg=PA1685}} It is the pivaloyloxymethyl ester derivative of valproic acid.{{cite book | vauthors = Hall JA, Morton IK | title = Concise dictionary of pharmacological agents: properties and synonyms | publisher = Kluwer Academic | year = 1999 | pages = 342 | isbn = 0-7514-0499-3 | url = https://books.google.com/books?id=mqaOMOtk61IC&q=%22valproate+pivoxil%22&pg=PA287}} It is likely a prodrug of valproic acid, as pivoxil esters are commonly employed to make prodrugs in medicinal chemistry.

See also

References

{{Reflist}}

{{Anticonvulsants}}

{{Mood stabilizers}}

{{GABA metabolism and transport modulators}}

{{HDAC inhibitors}}

{{Ion channel modulators}}

Category:Anticonvulsants

Category:GABA analogues

Category:GABA transaminase inhibitors

Category:Histone deacetylase inhibitors

Category:Mood stabilizers

Category:Prodrugs

Category:Pivalate esters

{{anticonvulsant-stub}}