vamicamide

{{Infobox drug

| drug_name = Vamicamide

| image = Vamicamide v2.svg

| width = 200px

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status = Investigational

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 132373-81-0

| CAS_supplemental =

| PubChem = 65967

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 59369

| UNII = RU10K34QRU

| KEGG =

| ChEBI =

| ChEMBL = 2114366

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = Urocut, FK-176

| IUPAC_name = (2R,4R)-4-(dimethylamino)-2-phenyl-2-pyridin-2-ylpentanamide

| C=18 | H=23 | N=3 | O=1

| SMILES = C[C@H](C[C@@](C1=CC=CC=C1)(C2=CC=CC=N2)C(=O)N)N(C)C

| StdInChI = 1S/C18H23N3O/c1-14(21(2)3)13-18(17(19)22,15-9-5-4-6-10-15)16-11-7-8-12-20-16/h4-12,14H,13H2,1-3H3,(H2,19,22)/t14-,18-/m1/s1

| StdInChIKey = BWNLUIXQIHPUGO-RDTXWAMCSA-N

}}

Vamicamide, also known as FK-176 or Urocut, is a muscarinic acetylcholine receptor (mAChR) antagonist that was developed by Fujisawa (now part of Astellas Pharma) for the treatment of urinary incontinence and overactive bladder. This small molecule drug acts by blocking muscarinic receptors, which play a role in bladder function. Despite showing promise in preclinical studies for increasing bladder capacity without affecting other urinary parameters,{{cite journal | vauthors = Yamamoto T, Koibuchi Y, Miura S, Sawada T, Ozaki R, Esumi K, Ohtsuka M | title = Effects of vamicamide on urinary bladder functions in conscious dog and rat models of urinary frequency | journal = The Journal of Urology | volume = 154 | issue = 6 | pages = 2174–8 | date = December 1995 | pmid = 7500484 | doi = 10.1016/S0022-5347(01)66723-5| url = }} vamicamide has never been approved for medical use. The drug's development was ultimately discontinued, with its highest research and development status reaching the New Drug Application (NDA) phase in Japan.{{cite web | title = Vamicamide | url = https://synapse.patsnap.com/drug/eaf5bdd08c71489181d6c8f1bc01a636 | work = PatSnap }}