vanadium hexacarbonyl

{{chembox

| verifiedrevid = 385833910

| Name = Vanadium hexacarbonyl

| ImageFile = V(CO)6.png

| ImageSize =

| ImageName = Vanadium hexacarbonyl

| IUPACName = hexacarbonylvanadium(0)

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 20644-87-5

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = WA8Q7FLK2X

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 37857

| PubChem = 519800

| RTECS =

| SMILES = O=C=[V](=C=O)(=C=O)(=C=O)(=C=O)=C=O

}}

|Section2={{Chembox Properties

| Formula = C6O6V

| MolarMass = 219.00 g/mol

| Appearance = blue-green crystals
yellow solutions

| Density = 1.7 g/cm3

| Solubility = insoluble

| Solvent = other solvents

| SolubleOther = 5 g/L hexane;
more soluble in dichloromethane

| MeltingPt = decomposes

| BoilingPtC = 50

| BoilingPt= sublimes at

| BoilingPt_notes = (15 mmHg)

}}

|Section3={{Chembox Structure

| Coordination = octahedral

| CrystalStruct = orthorhombic

| Dipole = 0 D

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards = CO source

| HPhrases =

| PPhrases =

| GHS_ref =

}}

|Section8={{Chembox Related

| OtherFunction_label = compounds

| OtherFunction = {{ubl|Chromium hexacarbonyl|Molybdenum hexacarbonyl|Tungsten hexacarbonyl|Seaborgium hexacarbonyl|Dimanganese decacarbonyl|Dirhenium decacarbonyl|Iron pentacarbonyl|Diiron nonacarbonyl|Triruthenium dodecacarbonyl|Triosmium dodecacarbonyl|Dicobalt octacarbonyl|Tetrarhodium dodecacarbonyl|Tetrairidium dodecacarbonyl|Nickel tetracarbonyl}}

}}

}}

Vanadium hexacarbonyl is the inorganic compound with the formula V(CO)6. It is a blue-black volatile solid. This highly reactive species is noteworthy from theoretical perspectives as a rare isolable homoleptic metal carbonyl that is paramagnetic. Most species with the formula Mx(CO)y follow the 18-electron rule, whereas V(CO)6 has 17 valence electrons.{{cite book|first1=C. |last1=Elschenbroich |first2=A. |last2=Salzer |title=Organometallics: A Concise Introduction |edition=2nd |date=1992 |publisher=Wiley-VCH |location=Weinheim |isbn=3-527-28165-7}}

Synthesis

According to the original synthesis by Calderazzo, V(CO)6 is prepared in two-steps via the intermediacy of {{chem|V(CO)|6|−}}. In the first step, VCl3 is reduced with metallic sodium under 200 atm CO at 160 °C. The solvent for this reduction is typically diglyme, CH3OCH2CH2OCH2CH2OCH3. This triether solubilizes sodium salts, akin to the behavior of a crown ether:

:4 Na + VCl3 + 6 CO + 2 diglyme → [Na(diglyme)2][V(CO)6] + 3 NaCl

The resulting anion is oxidized with acid:{{cite journal|last1=Liu |first1=X. |last2=Ellis |first2=J. E. |title=Hexacarbonylvanadate(1−) and Hexacarbonylvanadium(0) |journal=Inorg. Synth.|date=2004 |volume=34 |pages=96–103 |doi=10.1002/0471653683.ch3| isbn=0-471-64750-0}}

:2 {{chem|V(CO)|6|−}} + 2 H3PO4 → 2 V(CO)6 + H2 + 2 {{chem|H|2|PO|4|−}}

Reactions

Vanadium hexacarbonyl is thermally unstable. Its primary reaction is reduction to the monoanion {{chem|V(CO)|6|−}}, salts of which are well studied. It is also susceptible to substitution by tertiary phosphine ligands, often leading to disproportionation.

V(CO)6 reacts with sources of the cyclopentadienyl anion to give the orange four-legged piano stool complex (C5H5)V(CO)4 (m.p. 136 °C). Like many charge-neutral organometallic compounds, this half-sandwich species is volatile. In the original preparation of this species, C5H5HgCl was employed as the source of {{chem|C|5|H|5|−}}.

Structure

V(CO)6 adopts an octahedral coordination geometry and is isostructural with chromium hexacarbonyl, even though they have differing valence electron counts. High resolution X-ray crystallography indicates that the molecule is slightly distorted with two (axial) shorter V–C distances of 1.993(2) Å vs. four (equatorial) 2.005(2) Å. Even though V(−I) is a larger ion than V(0), the V–C distances in {{chem|V(CO)|6|−}} are 0.07 Å shorter than in the neutral precursor.{{cite journal|last1=Bellard |first1=S. |last2=Rubinson |first2=K. A. |last3=Sheldrick |first3=G. M. |title=Crystal and Molecular Structure of Vanadium Hexacarbonyl |journal=Acta Crystallographica |date=1979 |volume=B35 |issue=2 |pages=271–274 |doi=10.1107/S0567740879003332|doi-access= |bibcode=1979AcCrB..35..271B }}

References

{{reflist}}

Further reading

  • Original synthesis: {{cite journal|last1=Ercoli |first1=R.|last2=Calderazzo |first2=F.|last3=Alberola|first3=A. |title=Synthesis of Vanadium Hexacarbonyl |journal=J. Am. Chem. Soc. |date=1960 |volume=81 |issue=11|pages=2966–2967 |doi=10.1021/ja01496a073}}

{{Vanadium compounds}}

{{Carbonyl complexes}}

Category:Vanadium compounds

Category:Carbonyl complexes