veliparib

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 451225132

| image = Veliparib skeletal.svg

| tradename =

| pregnancy_AU =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| ATC_prefix = L01

| ATC_suffix = XK05

| ATC_supplemental =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 7417

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 912444-00-9

| CAS_supplemental =

| PubChem = 11960529

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 01O4K0631N

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank =DB07232

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 10134775

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 506871

| KEGG = D09692

| IUPAC_name = 2-((R)-2-Methylpyrrolidin-2-yl)-1H-benzimidazole-4-carboxamide

| C=13 | H=16 | N=4 | O=1

| smiles = C[C@]3(c2nc1c(C(N)=O)cccc1[nH]2)CCCN3

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C13H16N4O/c1-13(6-3-7-15-13)12-16-9-5-2-4-8(11(14)18)10(9)17-12/h2,4-5,15H,3,6-7H2,1H3,(H2,14,18)(H,16,17)/t13-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = JNAHVYVRKWKWKQ-CYBMUJFWSA-N

}}

Veliparib (ABT-888){{cite journal | vauthors = Donawho CK, Luo Y, Luo Y, Penning TD, Bauch JL, Bouska JJ, Bontcheva-Diaz VD, Cox BF, DeWeese TL, Dillehay LE, Ferguson DC, Ghoreishi-Haack NS, Grimm DR, Guan R, Han EK, Holley-Shanks RR, Hristov B, Idler KB, Jarvis K, Johnson EF, Kleinberg LR, Klinghofer V, Lasko LM, Liu X, Marsh KC, McGonigal TP, Meulbroek JA, Olson AM, Palma JP, Rodriguez LE, Shi Y, Stavropoulos JA, Tsurutani AC, Zhu GD, Rosenberg SH, Giranda VL, Frost DJ | display-authors = 6 | title = ABT-888, an orally active poly(ADP-ribose) polymerase inhibitor that potentiates DNA-damaging agents in preclinical tumor models | journal = Clinical Cancer Research | volume = 13 | issue = 9 | pages = 2728–2737 | date = May 2007 | pmid = 17473206 | doi = 10.1158/1078-0432.CCR-06-3039 | s2cid = 15532443 | doi-access = free }} is a potential anti-cancer drug acting as a PARP inhibitor. It kills cancer cells by blocking a protein called PARP, thereby preventing the repair of DNA or genetic damage in cancer cells and possibly making them more susceptible to anticancer treatments. Veliparib may make whole brain radiation treatment work more effectively against brain metastases from NSCLC. It has been shown to potentiate the effects of many chemotherapeutics, and as such has been part of many combination clinical trials.

It inhibits both PARP1 and PARP2 and thereby induces synthetic lethality. It is still being evaluated for the treatment of ovarian cancer.{{cite journal | vauthors = Boussios S, Karihtala P, Moschetta M, Abson C, Karathanasi A, Zakynthinakis-Kyriakou N, Ryan JE, Sheriff M, Rassy E, Pavlidis N | display-authors = 6 | title = Veliparib in ovarian cancer: a new synthetically lethal therapeutic approach | journal = Investigational New Drugs | volume = 38 | issue = 1 | pages = 181–193 | date = February 2020 | pmid = 31650446 | doi = 10.1007/s10637-019-00867-4 | s2cid = 204882729 }}