velneperit

{{short description|Chemical compound}}

{{Drugbox

| IUPAC_name = trans-4-(tert-butylsulfonylamino)-N-[5-(trifluoromethyl)pyridin-2-yl]cyclohexane-1-carboxamide

| image = Velneperit.svg

| width = 240

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| excretion =

| CAS_number = 342577-38-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 09BQ2KJ22J

| ATC_prefix = None

| ATC_suffix =

| PubChem = 20629114

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID = 25948511

| ChEMBL =

| C=17 | H=24 | F=3 | N=3 | O=3 | S=1

| smiles = CC(C)(C)S(=O)(=O)NC2CCC(CC2)C(=O)Nc1ncc(C(F)(F)F)cc1

| StdInChI = 1S/C17H24F3N3O3S/c1-16(2,3)27(25,26)23-13-7-4-11(5-8-13)15(24)22-14-9-6-12(10-21-14)17(18,19)20/h6,9-11,13,23H,4-5,7-8H2,1-3H3,(H,21,22,24)/t11-,13-

| StdInChIKey = WGEWUYACXPEFPO-AULYBMBSSA-N

| synonyms =

}}

Velneperit (S-2367) is a drug developed by Shionogi, which acts as a potent and selective antagonist for the Neuropeptide Y receptor Y5. It has anorectic effects and was developed as a possible treatment for obesity, but was discontinued from further development after disappointing results in Phase II clinical trials. However it was still considered a successful proof of concept of the potential of Y5 receptor antagonists as possible anti-obesity agents in future.{{cite journal | vauthors = Yukioka H | title = [A potent and selective neuropeptide Y Y5-receptor antagonist, S-2367, as an anti-obesity agent] | language = ja | journal = Nihon Yakurigaku Zasshi. Folia Pharmacologica Japonica | volume = 136 | issue = 5 | pages = 270–4 | date = November 2010 | pmid = 21079365 | doi = 10.1254/fpj.136.270 | doi-access = free }}{{cite journal | vauthors = Oda S, Manaka K, Kakiya K, Hozumi Y, Fukui Y, Omura S, Kurashita M, Nishiwaki M, Takeuchi Y, Kitamura H | display-authors = 6 | title = Development of an Optimized Synthetic and Purification Process of S-2367 (Velneperit), a Novel Neuropeptide Y (NPY) Y5 Receptor Antagonist. | journal = Organic Process Research & Development | date = April 2015 | volume = 19 | issue = 4 | pages = 531–6 | doi = 10.1021/acs.oprd.5b00023 }}{{cite journal | vauthors = George M, Rajaram M, Shanmugam E | title = New and emerging drug molecules against obesity | journal = Journal of Cardiovascular Pharmacology and Therapeutics | volume = 19 | issue = 1 | pages = 65–76 | date = January 2014 | pmid = 24064009 | doi = 10.1177/1074248413501017 | s2cid = 34327832 }}

References