vilaprisan

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (8S,11R,13S,14S,17S)-17-Hydroxy-13-methyl-11-(4-methylsulfonylphenyl)-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one

| image = Vilaprisan.svg

| width = 250px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = By mouth

| class = Selective progesterone receptor modulator

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 1262108-14-4

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 50915138

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 32699892

| UNII = IN59K53GI9

| KEGG = D11181

| ChEBI =

| ChEMBL =

| synonyms = BAY-1002670; 17β-Hydroxy-11β-[4-(methylsulfonyl)phenyl]-17α-(1,1,2,2,2-pentafluoroethyl)estra-4,9-dien-3-one

| C=27 | H=29 | F=5 | O=4 | S=1

| SMILES = C[C@]12C[C@@H](C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@]2(C(C(F)(F)F)(F)F)O)C5=CC=C(C=C5)S(=O)(=O)C

| StdInChI_Ref =

| StdInChI = 1S/C27H29F5O4S/c1-24-14-21(15-3-7-18(8-4-15)37(2,35)36)23-19-10-6-17(33)13-16(19)5-9-20(23)22(24)11-12-25(24,34)26(28,29)27(30,31)32/h3-4,7-8,13,20-22,34H,5-6,9-12,14H2,1-2H3/t20-,21+,22-,24-,25-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = JUFWQQVHQFDUOD-ANRPBIDPSA-N

}}

Vilaprisan ({{abbrlink|INN|International Nonproprietary Name}}, {{abbrlink|USAN|United States Adopted Name}}) (developmental code name BAY-1002670) is a synthetic and steroidal selective progesterone receptor modulator (SPRM) which is under development by Bayer HealthCare Pharmaceuticals for the treatment of endometriosis and uterine fibroids.{{Cite web|url=http://adisinsight.springer.com/drugs/800033040|title = Vilaprisan - Bayer HealthCare Pharmaceuticals - AdisInsight}}{{cite journal | vauthors = Whitaker LH, Williams AR, Critchley HO | title = Selective progesterone receptor modulators | journal = Curr. Opin. Obstet. Gynecol. | volume = 26 | issue = 4 | pages = 237–42 | year = 2014 | pmid = 24950125 | doi = 10.1097/GCO.0000000000000082 | s2cid = 37474964 }}{{cite journal | vauthors = Pluchino N, Freschi L, Wenger JM, Streuli I | title = Innovations in classical hormonal targets for endometriosis | journal = Expert Rev Clin Pharmacol | volume = 9 | issue = 2 | pages = 317–27 | year = 2016 | pmid = 26645363 | doi = 10.1586/17512433.2016.1129895 | s2cid = 8624056 }} It is a potent and highly selective partial agonist of the progesterone receptor (PR).{{cite journal | vauthors = Schütt B, Kaiser A, Schultze-Mosgau MH, Seitz C, Bell D, Koch M, Rohde B | title = Pharmacodynamics and safety of the novel selective progesterone receptor modulator vilaprisan: a double-blind, randomized, placebo-controlled phase 1 trial in healthy women | journal = Hum. Reprod. | volume = 31 | issue = 8 | pages = 1703–12 | year = 2016 | pmid = 27288475 | doi = 10.1093/humrep/dew140 | doi-access = free }} As of 2017, the drug is in phase II clinical trials for the aforementioned indications.