vinbarbital

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 470630345

| IUPAC_name = 5-ethyl-5-[(1E)-1-methylbut-1-en-1-yl]pyrimidine-2,4,6(1H,3H,5H)-trione

| image = Vinbarbital_skeletal.svg

| width = 100

| tradename =

| pregnancy_category =

| legal_CA = Schedule IV

| legal_US = Schedule III

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 125-42-8

| ATC_prefix = N05

| ATC_suffix = CA09

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 503565

| PubChem = 5284636

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4447681

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7NZH2C1T6O

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07322

| C=11 | H=16 | N=2 | O=3

| smiles = O=C1NC(=O)NC(=O)C1(/C(=C/CC)C)CC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C11H16N2O3/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h6H,4-5H2,1-3H3,(H2,12,13,14,15,16)/b7-6+

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = RAFOHKSPUDGZPR-VOTSOKGWSA-N

}}

Vinbarbital is a hypnotic drug which is a barbiturate derivative.{{cite journal | vauthors = Mueller VA | title = An analysis and evaluation of vinbarbital sodium for obstetric amnesia and analgesia | journal = American Journal of Obstetrics and Gynecology | volume = 59 | issue = 3 | pages = 679–84 | date = March 1950 | pmid = 15405833 | doi = 10.1016/0002-9378(50)90253-5 }} It was developed by Sharp and Dohme in 1939.{{Patent |US|2187703}}