voglibose

{{Drugbox

| verifiedrevid = 470631324

| IUPAC_name = (1S,2S,3R,4S,5S)-5-(1,3-dihydroxypropan-2-ylamino)-1-(hydroxymethyl)cyclohexane-1,2,3,4-tetraol

| image = Voglibose structure.svg

| tradename =

| Drugs.com = {{drugs.com|international|voglibose}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 83480-29-9

| ATC_prefix = A10

| ATC_suffix = BF03

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 476960

| PubChem = 444020

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB04878

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 392046

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = S77P977AG8

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01665

| C=10 | H=21 | N=1 | O=7

| smiles = OC[C@@]1(O)C[C@H](NC(CO)CO)[C@H](O)[C@@H](O)[C@@H]1O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H21NO7/c12-2-5(3-13)11-6-1-10(18,4-14)9(17)8(16)7(6)15/h5-9,11-18H,1-4H2/t6-,7-,8+,9-,10-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FZNCGRZWXLXZSZ-CIQUZCHMSA-N

}}

Voglibose (INN and USAN, trade name Voglib, marketed by Mascot Health Series) is an alpha-glucosidase inhibitor used for lowering postprandial blood glucose levels in people with diabetes mellitus.{{cite journal | vauthors = Chen X, Zheng Y, Shen Y | title = Voglibose (Basen, AO-128), one of the most important alpha-glucosidase inhibitors | journal = Current Medicinal Chemistry | volume = 13 | issue = 1 | pages = 109–116 | date = 2006 | pmid = 16457643 | doi = 10.2174/092986706789803035 }} Voglibose is a research product of Takeda Pharmaceutical Company, Japan's largest pharmaceutical company. Voglibose was discovered in 1981, and was first launched in Japan in 1994,{{cite journal | vauthors = Dabhi AS, Bhatt NR, Shah MJ | title = Voglibose: an alpha glucosidase inhibitor | journal = Journal of Clinical and Diagnostic Research | volume = 7 | issue = 12 | pages = 3023–3027 | date = December 2013 | pmid = 24551718 | pmc = 3919386 | doi = 10.7860/JCDR/2013/6373.3838 }} under the trade name BASEN, to improve postprandial hyperglycemia in diabetes mellitus.{{cite web | title = Voglibose | url = https://adisinsight.springer.com/drugs/800001172 | work = AdisInsight | publisher = Springer Nature Switzerland AG }}

Postprandial hyperglycemia (PPHG) is primarily due to first phase insulin secretion. Alpha glucosidase inhibitors delay glucose absorption at the intestine level and thereby prevent sudden surge of glucose after a meal.

There are three major drugs which belong to this class, acarbose, miglitol and voglibose, of which voglibose is the newest.

Efficacy

A Cochrane systematic review assessed the effect of alpha-glucosidase inhibitors in people with impaired glucose tolerance, impaired fasting blood glucose, elevated glycated hemoglobin A1c (HbA1c).{{cite journal | vauthors = Moelands SV, Lucassen PL, Akkermans RP, De Grauw WJ, Van de Laar FA | title = Alpha-glucosidase inhibitors for prevention or delay of type 2 diabetes mellitus and its associated complications in people at increased risk of developing type 2 diabetes mellitus | journal = The Cochrane Database of Systematic Reviews | volume = 2018 | issue = 12 | pages = CD005061 | date = December 2018 | pmid = 30592787 | pmc = 6517235 | doi = 10.1002/14651858.CD005061.pub3 |collaboration = Cochrane Metabolic and Endocrine Disorders Group }} It was found that there was no conclusive evidence that voglibose compared to diet and exercise or placebo reduced incidence of diabetes mellitus type 2, improved all-cause mortality, reduced or increased risk of cardiovascular mortality, serious or non-serious adverse events, non-fatal stroke, congestive heart failure, or non-fatal myocardial infarction.

voglibose

Efficacy

References

Further reading