vorsetuzumab mafodotin
{{Short description|Chemical compound}}
{{Drugbox
| type = mab
| image = Mafodotin ADCs.svg
| alt =
| mab_type =
| source = zu/o
| target = CD70
| tradename =
| Drugs.com =
| MedlinePlus =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category=
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status = Discontinued
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 1165741-01-4
| CAS_number_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 699619YVTQ
| ATC_prefix = none
| ATC_suffix =
| PubChem =
| DrugBank =
| ChemSpiderID = none
| synonyms = SGN-75
| KEGG = D10341
| chemical_formula = C6476H10006N1726O2028S50(C49H78N6O11)3-5
| molecular_weight = 150
| molecular_weight_comment = kg/mol
}}
Vorsetuzumab mafodotin (SGN-75) is an antibody-drug conjugate (ADC) directed to the protein CD70 designed for the treatment of cancer.[http://www.ama-assn.org/resources/doc/usan/vorsetuzumab-mafodotin.pdf Statement On A Nonproprietary Name Adopted By The USAN Council: Vorsetuzumab Mafodotin], American Medical Association. It is a humanized monoclonal antibody, vorsetuzumab, conjugated with noncleavable monomethyl auristatin F (MMAF), a cytotoxic agent.{{cn|date=February 2023}}
This drug was developed by Seattle Genetics, Inc. The drug completed phase I clinical trials for renal cell carcinoma,Clinical trials for SGN-75 [http://clinicaltrials.gov/search/intervention=SGN-75+OR+%22Vorsetzumab+Mafodotin%22 "Clinicaltrials.gov"] but development was discontinued in 2013.[http://investor.seattlegenetics.com/phoenix.zhtml?c=124860&p=irol-newsArticle_Print&ID=1872671&highlight=, Seattle Genetics Third Quarter 2013 Financial Report]{{Dead link|date=January 2024 |bot=InternetArchiveBot |fix-attempted=yes }}
No reason was given but SG plan to start clinical trials of SGN-CD70A in 2014.
References
{{Monoclonals for tumors}}
{{Cytokine receptor modulators}}
{{monoclonal-antibody-stub}}
Category:Monoclonal antibodies for tumors