vorsetuzumab mafodotin

{{Short description|Chemical compound}}

{{Drugbox

| type = mab

| image = Mafodotin ADCs.svg

| alt =

| mab_type =

| source = zu/o

| target = CD70

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Discontinued

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 1165741-01-4

| CAS_number_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 699619YVTQ

| ATC_prefix = none

| ATC_suffix =

| PubChem =

| DrugBank =

| ChemSpiderID = none

| synonyms = SGN-75

| KEGG = D10341

| chemical_formula = C6476H10006N1726O2028S50(C49H78N6O11)3-5

| molecular_weight = 150

| molecular_weight_comment = kg/mol

}}

Vorsetuzumab mafodotin (SGN-75) is an antibody-drug conjugate (ADC) directed to the protein CD70 designed for the treatment of cancer.[http://www.ama-assn.org/resources/doc/usan/vorsetuzumab-mafodotin.pdf Statement On A Nonproprietary Name Adopted By The USAN Council: Vorsetuzumab Mafodotin], American Medical Association. It is a humanized monoclonal antibody, vorsetuzumab, conjugated with noncleavable monomethyl auristatin F (MMAF), a cytotoxic agent.{{cn|date=February 2023}}

This drug was developed by Seattle Genetics, Inc. The drug completed phase I clinical trials for renal cell carcinoma,Clinical trials for SGN-75 [http://clinicaltrials.gov/search/intervention=SGN-75+OR+%22Vorsetzumab+Mafodotin%22 "Clinicaltrials.gov"] but development was discontinued in 2013.[http://investor.seattlegenetics.com/phoenix.zhtml?c=124860&p=irol-newsArticle_Print&ID=1872671&highlight=, Seattle Genetics Third Quarter 2013 Financial Report]{{Dead link|date=January 2024 |bot=InternetArchiveBot |fix-attempted=yes }}

No reason was given but SG plan to start clinical trials of SGN-CD70A in 2014.

References

{{Monoclonals for tumors}}

{{Cytokine receptor modulators}}

{{monoclonal-antibody-stub}}

Category:Monoclonal antibodies for tumors

Category:Antibody-drug conjugates

Category:Experimental cancer drugs