w:Fucitol

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424722706

| ImageFile = L-Fucitol_chemical_structure.png

| ImageSize = 200px

| IUPACName = 1-Deoxy-L-galactitol

| SystematicName = (2R,3S,4R,5S)-Hexane-1,2,3,4,5-pentol

|Section1={{Chembox Identifiers

| CASNo = 13074-06-1

| CASNo_Ref = {{cascite|correct|}}

| CASNo_Comment = (L)

| CASNo1 = 5328-43-8

| CASNo1_Ref = {{cascite|changed|}}

| CASNo1_Comment = (D)

| CASNo2 = 37114-30-0

| CASNo2_Ref = {{cascite|changed|}}

| CASNo2_Comment = (DL)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 961570X3WO

| UNII_Comment = (L)

| PubChem = 445724

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 26329719

| ChemSpiderID_Comment = (L)

| ChemSpiderID1_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID1 = 393279

| ChemSpiderID1_Comment = (D)

| ChEBI = 42600

| SMILES = C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C6H14O5/c1-3(8)5(10)6(11)4(9)2-7/h3-11H,2H2,1H3/t3-,4+,5-,6-/m0/s1

| StdInChI_Comment = (L)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = SKCKOFZKJLZSFA-FSIIMWSLSA-N

}}

|Section2={{Chembox Properties

| Formula =

| C=6 | H=14 | O=5

| MolarMass = 166.17 g/mol

| Appearance =

| Density =

| MeltingPtC = 153 to 154

| MeltingPt_ref = {{cite journal | title = Fucitol |author1=Votocek, Emil |author2=Potmesil, R. Prag | journal = Berichte der Deutschen Chemischen Gesellschaft | year = 1914 | volume = 46 | pages = 3653–3655 | doi=10.1002/cber.191304603151|url=https://zenodo.org/record/1426533 }}

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Fucitol, also known as L-fucitol, 1-deoxy-L-galactitol, and (2R,3S,4R,5S)-hexane-1,2,3,4,5-pentol, is a sugar alcohol derived from fucoidan which is found in the North Atlantic seaweed Fucus vesiculosus{{cite journal | title = Degradative studies on fucoidin | author = O'Neill, A. N. | journal = Journal of the American Chemical Society | year = 1954 | volume = 76 | pages = 5074–5076 | doi = 10.1021/ja01649a018 | issue = 20| bibcode = 1954JAChS..76.5074O }} or by the reduction of fucose.

See also

References

{{reflist}}