w:Fucitol
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 424722706
| ImageFile = L-Fucitol_chemical_structure.png
| ImageSize = 200px
| IUPACName = 1-Deoxy-L-galactitol
| SystematicName = (2R,3S,4R,5S)-Hexane-1,2,3,4,5-pentol
|Section1={{Chembox Identifiers
| CASNo = 13074-06-1
| CASNo_Ref = {{cascite|correct|}}
| CASNo_Comment = (L)
| CASNo1 = 5328-43-8
| CASNo1_Ref = {{cascite|changed|}}
| CASNo1_Comment = (D)
| CASNo2 = 37114-30-0
| CASNo2_Ref = {{cascite|changed|}}
| CASNo2_Comment = (DL)
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 961570X3WO
| UNII_Comment = (L)
| PubChem = 445724
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 26329719
| ChemSpiderID_Comment = (L)
| ChemSpiderID1_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID1 = 393279
| ChemSpiderID1_Comment = (D)
| ChEBI = 42600
| SMILES = C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C6H14O5/c1-3(8)5(10)6(11)4(9)2-7/h3-11H,2H2,1H3/t3-,4+,5-,6-/m0/s1
| StdInChI_Comment = (L)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = SKCKOFZKJLZSFA-FSIIMWSLSA-N
}}
|Section2={{Chembox Properties
| Formula =
| C=6 | H=14 | O=5
| MolarMass = 166.17 g/mol
| Appearance =
| Density =
| MeltingPtC = 153 to 154
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Fucitol, also known as L-fucitol, 1-deoxy-L-galactitol, and (2R,3S,4R,5S)-hexane-1,2,3,4,5-pentol, is a sugar alcohol derived from fucoidan which is found in the North Atlantic seaweed Fucus vesiculosus{{cite journal | title = Degradative studies on fucoidin | author = O'Neill, A. N. | journal = Journal of the American Chemical Society | year = 1954 | volume = 76 | pages = 5074–5076 | doi = 10.1021/ja01649a018 | issue = 20| bibcode = 1954JAChS..76.5074O }} or by the reduction of fucose.
See also
References
{{reflist}}