xanthoxin
{{Chembox
| Watchedfields = changed
| verifiedrevid = 450874464
| ImageFile = Xanthoxin.svg
| ImageSize = 200px
| PIN =
| SystematicName = (2Z,4E)-5-[(1S,4S,6R)-4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]-3-methylpenta-2,4-dienal
| OtherNames = Xanthoxal
| Section1 = {{Chembox Identifiers
| CASNo = 8066-07-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 390CLE3JBK
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 5282222
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4445403
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 32304
| SMILES = C[C@]12C[C@@H](O)CC(C)(C)[C@]2(/C=C/C(/C)=C\C=O)O1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C15H22O3/c1-11(6-8-16)5-7-15-13(2,3)9-12(17)10-14(15,4)18-15/h5-8,12,17H,9-10H2,1-4H3/b7-5+,11-6-/t12-,14+,15-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZTALKMXOHWQNIA-TVBSHJCBSA-N
}}
| Section2 = {{Chembox Properties
| C=15 | H=22 | O=3
| Appearance =
| Density = 1.15 g/mL
| MeltingPt =
| BoilingPtC = 371.1
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Xanthoxin is an intermediate in the biosynthesis of the plant hormone abscisic acid.{{cite journal | pmid = 11804826 | year = 2002 | last1 = Seo | first1 = M | last2 = Koshiba | first2 = T | title = Complex regulation of ABA biosynthesis in plants | volume = 7 | issue = 1 | pages = 41–8 | journal = Trends in Plant Science | doi=10.1016/S1360-1385(01)02187-2}}
