xibenolol

{{short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 1-(tert-Butylamino)-3-(2,3-dimethylphenoxy)propan-2-ol

| image = Xibenolol.png

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 30187-90-7

| ATC_prefix = none

| ATC_suffix =

| PubChem = 146256

| DrugBank =

| ChemSpiderID = 129009

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0871JY946G

| C=15 | H=25 | N=1 | O=2

| smiles = O(c1cccc(c1C)C)CC(O)CNC(C)(C)C

}}

Xibenolol is a beta blocker.{{cite web | url = http://apps.who.int/medicinedocs/en/d/Js4895e/6.html | archive-url = https://web.archive.org/web/20120307220148/http://apps.who.int/medicinedocs/en/d/Js4895e/6.html | url-status = dead | archive-date = March 7, 2012 | title = The Use of Common Stems in the Selection of International Nonproprietary Names (INN) for Pharmaceutical Substances: Alphabetical list of stems together with corresponding INNs}}{{cite journal | vauthors = Honma S, Ito T, Kambegawa A | title = Stereoselectivity in the metabolism of the beta-adrenergic blocking agent, (+/-)-1-tert-butylamino-3-(2,3-dimethylphenoxy)-2-propanol hydrochloride (xibenolol hydrochloride, D-32), in man | journal = Chemical & Pharmaceutical Bulletin | volume = 33 | issue = 2 | pages = 760–8 | date = February 1985 | pmid = 2861914 | doi = 10.1248/cpb.33.760 | doi-access = free }}