xylene cyanol

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477868890

| Name = Xylene cyanol

| ImageFile = Xylencyanol.svg

| ImageSize = 200px

| ImageName =

| PIN = Sodium 4-{(Z)-[3-methyl-4-(ethylamino)phenyl][3-methyl-4-(ethylimino)cyclohexa-2,5-dien-1-ylidene]methyl}-3-sulfobenzene-1-sulfonate

| OtherNames = Acid Blue 147
xylene cyanole
xylene cyanol FF
xylene cyanole FF
C.I. 42135

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 2650-17-1

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID=21106494

| EC_number = 220-167-5

| PubChem = 44135495

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C25H28N2O6S2.Na/c1-5-26-22-11-7-18(13-16(22)3)25(19-8-12-23(27-6-2)17(4)14-19)21-10-9-20(32-34(28)29)15-24(21)33-35(30)31;/h7-15,26H,5-6H2,1-4H3,(H,28,29)(H,30,31);/q;+1/p-1/b25-19-,27-23-;

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NLIVDORGVGAOOJ-KRQUPCAFSA-M

| InChI = 1S/C25H28N2O6S2.Na/c1-5-26-22-11-7-18(13-16(22)3)25(19-8-12-23(27-6-2)17(4)14-19)21-10-9-20(32-34(28)29)15-24(21)33-35(30)31;/h7-15,26H,5-6H2,1-4H3,(H,28,29)(H,30,31);/q;+1/p-1/b25-19-,27-23-;

| InChIKey1 = NLIVDORGVGAOOJ-KRQUPCAFSA-M

| SMILES = [Na+].CCNc1ccc(cc1C)/C(=C2/C=C\C(=[NH+]\CC)C(=C2)C)c3ccc(OS([O-])=O)cc3OS([O-])=O

}}

| Section2 = {{Chembox Properties

| C=25|H=27|N=2|Na=1|O=6|S=2

| Density =

| MeltingPt =

| BoilingPt =

}}

| Section7={{Chembox Hazards

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|319|335}}

| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}

}}

}}

Xylene cyanol can be used as an electrophoretic color marker, or tracking dye, to monitor the process of agarose gel electrophoresis and polyacrylamide gel electrophoresis. Bromophenol blue and orange G can also be used for this purpose.

Once mixed with the sample, the concentration of xylene cyanol is typically about 0.005% to 0.03%.