zalospirone

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 448228579

| IUPAC_name = (3aα,4α,4aβ,6aβ,7α,7aα)-Hexahydro-2-(4-(4-(2-pyrimidinyl)-1-piperazinyl)butyl)-4,7-etheno-1H-cyclobut[f]isoindole-1,3(2H)-dione

| image = Zalospirone.svg

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life = 1-4 hours

| excretion =

| CAS_number = 114298-18-9

| ATC_prefix = none

| ATC_suffix =

| PubChem = 163925

| ChemSpiderID = 143768

| IUPHAR_ligand = 58

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0449O95Z1J

| C=24 | H=29 | N=5 | O=2

| smiles = O=C1N(C(=O)[C@@H]4[C@H]1[C@@H]2\C=C/[C@H]4[C@H]3\C=C/[C@@H]23)CCCCN6CCN(c5ncccn5)CC6

| StdInChI = 1S/C24H29N5O2/c30-22-20-18-6-7-19(17-5-4-16(17)18)21(20)23(31)29(22)11-2-1-10-27-12-14-28(15-13-27)24-25-8-3-9-26-24/h3-9,16-21H,1-2,10-15H2/t16-,17+,18-,19+,20-,21+

| StdInChIKey = AERLHOTUXIJQFV-RCPZPFRWSA-N

}}

Zalospirone (WY-47,846) is a selective 5-HT_1A partial agonist of the azapirone chemical class.{{cite journal | vauthors = Gleeson S, Barrett JE | title = 5-HT1A agonist effects on punished responding of squirrel monkeys | journal = Pharmacology, Biochemistry, and Behavior | volume = 37 | issue = 2 | pages = 335–7 | date = October 1990 | pmid = 1981937 | doi = 10.1016/0091-3057(90)90344-H | s2cid = 23488390 }}{{cite journal | vauthors = Singh A, Lucki I | title = Antidepressant-like activity of compounds with varying efficacy at 5-HT1A receptors | journal = Neuropharmacology | volume = 32 | issue = 4 | pages = 331–40 | date = April 1993 | pmid = 8497336 | doi = 10.1016/0028-3908(93)90153-T | s2cid = 38611829 }} It was found to be effective in the treatment of anxiety and depression in clinical trials, but a high proportion of subjects dropped out due to side effects and development was subsequently never completed.{{cite journal | vauthors = Rickels K, Derivan A, Kunz N, Pallay A, Schweizer E | title = Zalospirone in major depression: a placebo-controlled multicenter study | journal = Journal of Clinical Psychopharmacology | volume = 16 | issue = 3 | pages = 212–7 | date = June 1996 | pmid = 8784652 | doi = 10.1097/00004714-199606000-00004 }}