zelandopam

{{Short description|Abandoned D1-like receptor agonist}}

{{Infobox drug

| drug_name =

| image = Zelandopam.svg

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration = Intravenous administration

| class = Dopamine D₁-like receptor agonists

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 139233-53-7

| CAS_supplemental =
138086-00-7 (hydrochloride)

| PubChem = 3078105

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 2336394

| UNII = IR6XYD8SAX

| KEGG =

| ChEBI =

| ChEMBL = 2105532

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = Selandopam; (–)-(S)-7,8-Dihydroxy-4-(3,4-dihydroxyphenyl)-1,2,3,4-tetrahydroisoquinoline; 7,8-DDPTI; YM-435; YM435; MYD-37; MYD37

| IUPAC_name = (4S)-4-(3,4-dihydroxyphenyl)-1,2,3,4-tetrahydroisoquinoline-7,8-diol

| C=15 | H=15 | N=1 | O=4

| SMILES = C1[C@H](C2=C(CN1)C(=C(C=C2)O)O)C3=CC(=C(C=C3)O)O

| StdInChI = 1S/C15H15NO4/c17-12-3-1-8(5-14(12)19)10-6-16-7-11-9(10)2-4-13(18)15(11)20/h1-5,10,16-20H,6-7H2/t10-/m0/s1

| StdInChIKey = FULLEMQICAKPOE-JTQLQIEISA-N

}}

Zelandopam ({{Abbrlink|INN|International Nonproprietary Name}}; developmental code names YM-435, MYD-37) is a selective dopamine D₁-like receptor agonist related to fenoldopam which was under development in Japan for the treatment of hypertension and heart failure but was never marketed.{{cite web | title=Zelandopam hydrochloride | website=AdisInsight | date=22 May 2002 | url=https://adisinsight.springer.com/drugs/800002584 | access-date=21 October 2024}}{{cite journal | vauthors = Doggrell SA | title = The therapeutic potential of dopamine modulators on the cardiovascular and renal systems | journal = Expert Opin Investig Drugs | volume = 11 | issue = 5 | pages = 631–644 | date = May 2002 | pmid = 11996645 | doi = 10.1517/13543784.11.5.631 | url = }}{{cite journal | vauthors = Vaz de Castro PA, Jose PA, Simões e Silva AC | title = Interactions between the intrarenal dopaminergic and the renin-angiotensin systems in the control of systemic arterial pressure | journal = Clin Sci (Lond) | volume = 136 | issue = 16 | pages = 1205–1227 | date = August 2022 | pmid = 35979889 | doi = 10.1042/CS20220338 | url = }} The drug was being developed for use by intravenous administration. The development of zelandopam appears to have been discontinued by the early 2000s. It was first described in the scientific literature by 1991.Giammattei, C. E., Handa, R. K., & Strandhoy, J. W. (1991). The DA1 agonists, YM435 (YM) and fenoldopam (F), inhibit oxygen consumption (QO2) in rat renal proximal tubules. Pharmacologist, 33, 210p. https://scholar.google.com/scholar?cluster=13521937496129958590