zenarestat

{{chembox

| verifiedrevid =

|ImageFile = Zenarestat structure.svg

|ImageSize = 222

|PIN = {3-[(4-Bromo-2-fluorophenyl)methyl]-7-chloro-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl}acetic acid

|OtherNames =

|Section1 = {{Chembox Identifiers

| IUPHAR_ligand = 7418

| CASNo = 112733-06-9

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 180C9PJ8JT

| PubChem = 5724

| ChemSpiderID = 5522

| KEGG = D03807

| SMILES = C1=CC2=C(C=C1Cl)N(C(=O)N(C2=O)CC3=C(C=C(C=C3)Br)F)CC(=O)O

| InChI = 1/C17H11BrClFN2O4/c18-10-2-1-9(13(20)5-10)7-22-16(25)12-4-3-11(19)6-14(12)21(17(22)26)8-15(23)24/h1-6H,7-8H2,(H,23,24)

| InChIKey = SXONDGSPUVNZLO-UHFFFAOYAB

| StdInChI = 1S/C17H11BrClFN2O4/c18-10-2-1-9(13(20)5-10)7-22-16(25)12-4-3-11(19)6-14(12)21(17(22)26)8-15(23)24/h1-6H,7-8H2,(H,23,24)

| StdInChIKey = SXONDGSPUVNZLO-UHFFFAOYSA-N

}}

|Section2 = {{Chembox Properties

|C = 17 | H = 11 | Br = 1 | Cl = 1 | F = 1 | N = 2 | O = 4

| MolarMass = 441.64 g/mol

| Appearance =

| Density =

| MeltingPtC = 223 to 224

| BoilingPt =

| Solubility =

}}

|Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Zenarestat (FK-366; FR-74366) is an aldose reductase inhibitor. It was investigated as a treatment of diabetic neuropathy and cataract, but its development was terminated.{{cite web|title=Zenarestat — AdisInsight|url=http://adisinsight.springer.com/drugs/800000004|website=Adis Insight|publisher=Springer International Publishing AG|access-date=3 January 2016}}

References

  • M. Hashimoto et al., EP 218999; eidem, US 4734419 (1987, 1988 both to Fujisawa)
  • Inhibition kinetics and effect on sorbitol accumulation: S. Ao et al., Metabolism 40, 77 (1991)
  • Pharmacokinetics and metabolism in diabetic rats: Y. Tanaka et al., Drug Metab. Dispos. 21, 677 (1993)
  • M. Kanamaru et al., J. Clin. Pharmacol. 33, 1122 (1993).

{{reflist}}

{{oral hypoglycemics}}

Category:Abandoned drugs

Category:Aldose reductase inhibitors

Category:Orphan drugs

{{gastrointestinal-drug-stub}}