zenarestat
{{chembox
| verifiedrevid =
|ImageFile = Zenarestat structure.svg
|ImageSize = 222
|PIN = {3-[(4-Bromo-2-fluorophenyl)methyl]-7-chloro-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl}acetic acid
|OtherNames =
|Section1 = {{Chembox Identifiers
| IUPHAR_ligand = 7418
| CASNo = 112733-06-9
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 180C9PJ8JT
| PubChem = 5724
| ChemSpiderID = 5522
| KEGG = D03807
| SMILES = C1=CC2=C(C=C1Cl)N(C(=O)N(C2=O)CC3=C(C=C(C=C3)Br)F)CC(=O)O
| InChI = 1/C17H11BrClFN2O4/c18-10-2-1-9(13(20)5-10)7-22-16(25)12-4-3-11(19)6-14(12)21(17(22)26)8-15(23)24/h1-6H,7-8H2,(H,23,24)
| InChIKey = SXONDGSPUVNZLO-UHFFFAOYAB
| StdInChI = 1S/C17H11BrClFN2O4/c18-10-2-1-9(13(20)5-10)7-22-16(25)12-4-3-11(19)6-14(12)21(17(22)26)8-15(23)24/h1-6H,7-8H2,(H,23,24)
| StdInChIKey = SXONDGSPUVNZLO-UHFFFAOYSA-N
}}
|Section2 = {{Chembox Properties
|C = 17 | H = 11 | Br = 1 | Cl = 1 | F = 1 | N = 2 | O = 4
| MolarMass = 441.64 g/mol
| Appearance =
| Density =
| MeltingPtC = 223 to 224
| BoilingPt =
| Solubility =
}}
|Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Zenarestat (FK-366; FR-74366) is an aldose reductase inhibitor. It was investigated as a treatment of diabetic neuropathy and cataract, but its development was terminated.{{cite web|title=Zenarestat — AdisInsight|url=http://adisinsight.springer.com/drugs/800000004|website=Adis Insight|publisher=Springer International Publishing AG|access-date=3 January 2016}}
References
- M. Hashimoto et al., EP 218999; eidem, US 4734419 (1987, 1988 both to Fujisawa)
- Inhibition kinetics and effect on sorbitol accumulation: S. Ao et al., Metabolism 40, 77 (1991)
- Pharmacokinetics and metabolism in diabetic rats: Y. Tanaka et al., Drug Metab. Dispos. 21, 677 (1993)
- M. Kanamaru et al., J. Clin. Pharmacol. 33, 1122 (1993).
{{reflist}}
{{oral hypoglycemics}}
Category:Aldose reductase inhibitors
{{gastrointestinal-drug-stub}}