zipeprol

{{MCN|date=April 2025}}

{{Short description|Cough suppressant drug}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 470637387

| IUPAC_name = 1-methoxy- 3-[4-(2-methoxy- 2-phenylethyl)piperazin- 1-yl]- 1-phenylpropan- 2-ol

| image = zipeprol.png

| image_class = skin-invert-image

| tradename =

| Drugs.com = {{drugs.com|international|zipeprol}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_BR = F2

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-07-24 |title=RDC Nº 804 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 804 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |url-status=live |archive-url=https://web.archive.org/web/20230827163149/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |archive-date=2023-08-27 |access-date=2023-08-27 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-07-25}}

| legal_DE = Anlage II

| legal_CA = Schedule III

| legal_UK = Class B

| legal_US = Schedule I

| legal_UN = P II

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 34758-83-3

| ATC_prefix = R05

| ATC_suffix = DB15

| PubChem = 36910

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 33868

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = G5MUV8139H

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07390

| C=23 | H=32 | N=2 | O=3

| smiles = OC(CN1CCN(CC1)CC(OC)c2ccccc2)C(OC)c3ccccc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C23H32N2O3/c1-27-22(19-9-5-3-6-10-19)18-25-15-13-24(14-16-25)17-21(26)23(28-2)20-11-7-4-8-12-20/h3-12,21-23,26H,13-18H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = VSTNNAYSCJQCQI-UHFFFAOYSA-N

}}

Zipeprol is a centrally acting cough suppressant developed in France in the 1970s.Patent {{cite patent| country=US | number=3718650 | pridate= 1970-03-02 | gdate=1973-02-27 | inventor = Mauvernay RY | title = New Derivatives of Substituted Piperazines}} It is not a morphinan derivative (in contrast to both codeine and dextromethorphan). Zipeprol acts as a local anaesthetic and has mucolytic, antihistamine and anticholinergic properties.{{cite journal | vauthors = Rispat G, Burgi H, Cosnier D, Duchêne-Marullaz P, Streichenberger G | title = General pharmacological properties of a new non-opiate antitussive: zipeprol (3024 CERM). I. Action on respiratory function and acute toxicity | journal = Arzneimittel-Forschung | volume = 26 | issue = 4 | pages = 523–30 | date = April 1976 | pmid = 8057 }} It is sold with several brand names such as Zinolta and Respilene. It is not available in the United States or Canada and has been discontinued in Europe. It is still available in some countries in Asia and South America.

Zipeprol has been misused in Korea as a deliriant. Such use is quite dangerous due to the risk of seizures and neurological damage at high dosages.{{cite journal | vauthors = Chung H, Park M, Hahn E, Choi H, Choi H, Lim M | title = Recent trends of drug abuse and drug-associated deaths in Korea | journal = Annals of the New York Academy of Sciences | volume = 1025 | issue = 1 | pages = 458–64 | date = October 2004 | pmid = 15542749 | doi = 10.1196/annals.1316.056 | bibcode = 2004NYASA1025..458C | s2cid = 10987790 }}