zometapine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 451637459

| IUPAC_name = 4-(3-chlorophenyl)-1,3-dimethyl-6,7-dihydro-2H-pyrazolo[3,4-e][1,4]diazepine

| image = Zometapine structure.svg

| width = 150

| tradename =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 51022-73-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9171J97IQP

| PubChem = 5361110

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4514671

| C=14 | H=15 | Cl=1 | N=4

| smiles = Clc3cccc(C/2=N/CC/N=C1/N(N\C(=C1\2)C)C)c3

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C14H15ClN4/c1-9-12-13(10-4-3-5-11(15)8-10)16-6-7-17-14(12)19(2)18-9/h3-5,8,18H,6-7H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = CJGOZEVWXQGMCS-UHFFFAOYSA-N

}}

Zometapine (CI-781) is an antidepressant drug which is a pyrazolodiazepine derivative. Its molecular structure closely resembles thienodiazepines and is unrelated to other antidepressant drug classes.{{cite journal | vauthors = Katz RJ | title = Effects of zometapine, a structurally novel antidepressant, in an animal model of depression | journal = Pharmacology, Biochemistry, and Behavior | volume = 21 | issue = 4 | pages = 487–90 | date = October 1984 | pmid = 6542226 | doi = 10.1016/s0091-3057(84)80027-1 | s2cid = 43507076 }}