(S)-DCPT
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Drugbox
| IUPAC_name = (2S)-5-(2-chlorophenyl)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine
| image = (S)-DCPT.svg
| width =
| tradename =
| routes_of_administration =
| CAS_number =
| UNII =
| ATC_prefix =
| PubChem = 156011291
| IUPHAR_ligand =
| ChemSpiderID =129494222
| ChEMBL = 4637900
| C=22 | H=28 | Cl=1 | N=1
| smiles = CCCN(CCC)[C@H]1CCC2=C(C1)C=CC=C2C3=CC=CC=C3Cl
| StdInChI = 1S/C22H28ClN/c1-3-14-24(15-4-2)18-12-13-19-17(16-18)8-7-10-20(19)21-9-5-6-11-22(21)23/h5-11,18H,3-4,12-16H2,1-2H3/t18-/m0/s1
| StdInChIKey = QSQZCAQYYCNBSR-SFHVURJKSA-N
}}
(S)-DCPT is an experimental drug from the 2-aminotetralin family, related to the selective 5-HT1A agonist 8-OH-DPAT. However, (S)-DPCT instead acts as a selective agonist for the 5-HT1B receptor, with moderate selectivity over 5-HT1D and good selectivity over 5-HT1A, 5-HT7, and other serotonin receptors.{{cite journal | vauthors = Perry CK, Casey AB, Felsing DE, Vemula R, Zaka M, Herrington NB, Cui M, Kellogg GE, Canal CE, Booth RG | title = Synthesis of novel 5-substituted-2-aminotetralin analogs: 5-HT1A and 5-HT7 G protein-coupled receptor affinity, 3D-QSAR and molecular modeling | journal = Bioorganic & Medicinal Chemistry | volume = 28 | issue = 3 | pages = 115262 | date = February 2020 | pmid = 31882369 | doi = 10.1016/j.bmc.2019.115262 | doi-access = free }}{{cite thesis | vauthors = McGlynn R | title = Insights into the molecular pharmacology of novel aminotetralins and known drug candidates at serotonin 5-HT1-type receptors. | degree = PhD | publisher = Northeastern University | date = 2023 | doi = 10.17760/D20537503 }}
See also
References
{{Reflist}}
{{Serotonergics}}
{{DEFAULTSORT:DCPT}}
Category:2-Chlorophenyl compounds
Category:Dipropylamino compounds
{{nervous-system-drug-stub}}