UH-301
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 451218812
| IUPAC_name = (S)-5-fluoro-8-hydroxy-2-(dipropylamino)tetralin
| image = UH-301.svg
| alt = Skeletal formula of UH-301
| width =
| image2 = UH-301-3D-spacefill.png
| alt2 = Space-filling model of the UH-301 molecule
| tradename =
| routes_of_administration =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 127126-22-1
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 1T7773JH5N
| ATC_prefix =
| PubChem =
| IUPHAR_ligand = 61
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID =
| C=16 | H=24 | F=1 | N=1 | O=1
| smiles = C2Cc1c(c(O)ccc1F)CC2N(CCC)CCC
}}
(S)-UH-301 is a drug and research chemical widely used in scientific studies. It acts as a selective 5-HT1A receptor silent antagonist.{{cite journal | vauthors = Björk L, Cornfield LJ, Nelson DL, Hillver SE, Andén NE, Lewander T, Hacksell U | title = Pharmacology of the novel 5-hydroxytryptamine1A receptor antagonist (S)-5-fluoro-8-hydroxy-2-(dipropylamino)tetralin: inhibition of (R)-8-hydroxy-2-(dipropylamino)tetralin-induced effects | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 258 | issue = 1 | pages = 58–65 | date = July 1991 | pmid = 1830099 }} It is structurally related to 8-OH-DPAT. UH-301 was found to produce a head-twitch response in mice which is usually typical of 5-HT2A agonist drugs, and has subsequently been used to investigate how 5-HT1A receptor activity modulates 5-HT2A receptors downstream.{{cite journal | vauthors = Darmani NA, Reeves SL | title = The mechanism by which the selective 5-HT1A receptor antagonist S-(-) UH 301 produces head-twitches in mice | journal = Pharmacology, Biochemistry, and Behavior | volume = 55 | issue = 1 | pages = 1–10 | date = September 1996 | pmid = 8870031 | doi = 10.1016/0091-3057(96)00072-X | s2cid = 25607128 }}