:1-Nitropyrene

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 426606332

| ImageFile = 1-nitropyrene.svg

| ImageSize = 200px

| PIN = 1-Nitropyrene

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 5522-43-0

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = TD1665I8Q4

| PubChem = 21694

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 20390

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 34107

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 167395

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ALRLPDGCPYIVHP-UHFFFAOYSA-N

| SMILES = [O-][N+](=O)c4ccc2ccc1cccc3c1c2c4cc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI=1S/C16H9NO2/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H

}}

|Section2={{Chembox Properties

| C=16 | H=9 | N=1 | O=2

| Appearance =

| Density = 1.422 g/mL

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

1-Nitropyrene is a by-product of combustion and is the predominant nitrated polycyclic aromatic hydrocarbon (pyrene) emitted in a diesel engine.{{cite web|url=http://ntp.niehs.nih.gov/ntp/htdocs/ST_rpts/tox034.pdf|title=NTP Technical Report on Toxicity Study of 1-Nitropyrene (CAS No. 5522-43-0) Administered by Inhalation to F344/N Rats|work=Toxicity Report Series Number 34|publisher=National Toxicology Program|accessdate=15 January 2011}} 1-Nitropyrene is listed as an IARC Group 2B carcinogen,[http://monographs.iarc.fr/ENG/Classification/ClassificationsAlphaOrder.pdf Agents Classified by the IARC Monographs] indicating it is possibly carcinogenic to humans.

References

{{commons category|1-Nitropyrene}}

{{reflist}}

{{DEFAULTSORT:Nitropyrene, 1-}}

{{aromatic-stub}}

Category:Nitroarenes

Category:Pyrenes

Category:IARC Group 2B carcinogens