:1-Nitropyrene
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 426606332
| ImageFile = 1-nitropyrene.svg
| ImageSize = 200px
| PIN = 1-Nitropyrene
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 5522-43-0
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = TD1665I8Q4
| PubChem = 21694
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 20390
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 34107
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 167395
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ALRLPDGCPYIVHP-UHFFFAOYSA-N
| SMILES = [O-][N+](=O)c4ccc2ccc1cccc3c1c2c4cc3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI=1S/C16H9NO2/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H
}}
|Section2={{Chembox Properties
| C=16 | H=9 | N=1 | O=2
| Appearance =
| Density = 1.422 g/mL
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
1-Nitropyrene is a by-product of combustion and is the predominant nitrated polycyclic aromatic hydrocarbon (pyrene) emitted in a diesel engine.{{cite web|url=http://ntp.niehs.nih.gov/ntp/htdocs/ST_rpts/tox034.pdf|title=NTP Technical Report on Toxicity Study of 1-Nitropyrene (CAS No. 5522-43-0) Administered by Inhalation to F344/N Rats|work=Toxicity Report Series Number 34|publisher=National Toxicology Program|accessdate=15 January 2011}} 1-Nitropyrene is listed as an IARC Group 2B carcinogen,[http://monographs.iarc.fr/ENG/Classification/ClassificationsAlphaOrder.pdf Agents Classified by the IARC Monographs] indicating it is possibly carcinogenic to humans.
References
{{commons category|1-Nitropyrene}}
{{reflist}}
{{DEFAULTSORT:Nitropyrene, 1-}}
{{aromatic-stub}}