:11-Dehydrocorticosterone

{{Chembox

| ImageFile = 11-Dehydrocorticosterone.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = 21-Hydroxypregn-4-ene-3,11,20-trione

| SystematicName = (1S,3aS,3bS,9aR,9bS,11aS)-1-(Hydroxyacetyl)-9a,11a-dimethyl-2,3,3a,3b,4,5,8,9,9a,9b,11,11a-dodecahydro-1H-cyclopenta[a]phenanthrene-7,10-dione

| OtherNames = 11-DHC; 11-Oxocorticosterone; 17-Deoxycortisone

| Section1 = {{Chembox Identifiers

| CASNo = 72-23-1

| ChEBI = 78600

| ChEMBL = 3244489

| PubChem = 5311364

| ChemSpiderID = 4470861

| StdInChI = 1S/C21H28O4/c1-20-8-7-13(23)9-12(20)3-4-14-15-5-6-16(18(25)11-22)21(15,2)10-17(24)19(14)20/h9,14-16,19,22H,3-8,10-11H2,1-2H3/t14-,15-,16+,19+,20-,21-/m0/s1

| StdInChIKey = FUFLCEKSBBHCMO-KJQYFISQSA-N

| SMILES = C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2C(=O)C[C@]4([C@H]3CC[C@@H]4C(=O)CO)C

| UNII = FO4V44A3G3

}}

| Section2 = {{Chembox Properties

| C=21 | H=28 | O=4

| MolarMass = 344.451 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

11-Dehydrocorticosterone (11-DHC), also known as 11-oxocorticosterone or 17-deoxycortisone, as well as 21-hydroxypregn-4-ene-3,11,20-trione, is a naturally occurring, endogenous corticosteroid related to cortisone and corticosterone.{{cite HMDB|author1-link=David S. Wishart|url=http://www.hmdb.ca/metabolites/HMDB04029|title=Showing metabocard for 11-Dehydrocorticosterone (HMDB04029)}} It is a potent mineralocorticoid, with generally greater such activity than that of corticosterone.