:AM-1714

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 1,9-dihydroxy-3-(2-methyloctan-2-yl)-6H-benzo[c]chromen-6-one

| image = AM-1714_structure.png

| width = 280px

| pregnancy_category =

| legal_status = uncontrolled

| CAS_number = 335371-37-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = E3OY6PCU04

| ATC_prefix =

| ATC_suffix =

| PubChem = 9950486

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8126097

| C=22|H=26|O=4

| smiles = O=C(O1)C2=C(C=C(O)C=C2)C3=C1C=C(C(C)(C)CCCCCC)C=C3O

| StdInChI = 1S/C22H26O4/c1-4-5-6-7-10-22(2,3)14-11-18(24)20-17-13-15(23)8-9-16(17)21(25)26-19(20)12-14/h8-9,11-13,23-24H,4-7,10H2,1-3H3

| StdInChIKey = BWKBVEVEQOCSCF-UHFFFAOYSA-N

}}

AM-1714 (part of the AM cannabinoid series) is a drug that acts as a reasonably selective agonist of the peripheral cannabinoid receptor CB2, with sub-nanomolar affinity and 490x selectivity over the related CB1 receptor. In animal studies it has both analgesic and anti-allodynia effects. The 9-methoxy derivative AM-1710 has similar CB2 affinity but only 54x selectivity over CB1.{{cite journal | vauthors = Khanolkar AD, Lu D, Ibrahim M, Duclos RI, Thakur GA, Malan TP, Porreca F, Veerappan V, Tian X, George C, Parrish DA, Papahatjis DP, Makriyannis A | display-authors = 6 | title = Cannabilactones: a novel class of CB2 selective agonists with peripheral analgesic activity | journal = Journal of Medicinal Chemistry | volume = 50 | issue = 26 | pages = 6493–500 | date = December 2007 | pmid = 18038967 | doi = 10.1021/jm070441u }}{{cite journal | vauthors = Rahn EJ, Zvonok AM, Thakur GA, Khanolkar AD, Makriyannis A, Hohmann AG | title = Selective activation of cannabinoid CB2 receptors suppresses neuropathic nociception induced by treatment with the chemotherapeutic agent paclitaxel in rats | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 327 | issue = 2 | pages = 584–91 | date = November 2008 | pmid = 18664590 | doi = 10.1124/jpet.108.141994 | pmc = 2682949 }}

See also

References

{{reflist}}

{{Cannabinoids}}

Category:AM cannabinoids

Category:Benzochromenes

Category:Coumarins

{{cannabinoid-stub}}