:Balsaminapentaol

{{Chembox

| verifiedrevid = 443413418

| ImageFile = Balsaminapentaol A.svg

| ImageSize =

| ImageAlt =

| IUPACName = (23R,24R)-9-Methyl-19-nor-9β,10α-lanosta-5,25-diene-3β,7β,23,24,29-pentol

| SystematicName = (1R,3aS,3bR,4S,6S,7S,9aS,9bS,11aR)-1-[(2R,4R,5R)-4,5-Dihydroxy-6-methylhept-6-en-2-yl]-6-(hydroxymethyl)-3a,6,9b,11a-tetramethyl-2,3,3a,3b,4,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthrene-4,7-diol

| OtherNames = Cucurbita-5,25-diene-3β,7β,23R,24R,29-pentaol; (3β,4β,7β,9β,10α,23R,24R)-4-(Hydroxymethyl)-4,9,14-trimethyl-19-norcholesta-5,25-diene-3,7,23,24-tetrol; Balsaminapentaol A

| Section1 = {{Chembox Identifiers

| CASNo = 1189131-49-4

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2T3PK8ZV3C

| PubChem = 44607275

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1078341

| SMILES = C[C@H](C[C@@H](O)[C@H](O)C(C)=C)[C@@]1([H])CC[C@@]2(C)[C@]3([H])[C@@H](O)C=C4[C@@](C)(CO)[C@@H](O)CC[C@@]4([H])[C@]3(C)CC[C@@]21C

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 24531941

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI=1S/C30H50O5/c1-17(2)25(35)22(32)14-18(3)19-10-11-30(7)26-23(33)15-21-20(8-9-24(34)28(21,5)16-31)27(26,4)12-13-29(19,30)6/h15,18-20,22-26,31-35H,1,8-14,16H2,2-7H3/t18-,19-,20-,22-,23+,24+,25-,26-,27+,28-,29-,30+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LJWAEAIXBCCHLR-ITWKNSBQSA-N

}}

| Section2 = {{Chembox Properties

| C=30 | H=50 | O=5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Balsaminapentaol or cucurbita-5,25-diene-3β,7β,23(R),24(R),29-pentaol, is a chemical compound with formula {{chem|C|30|H|50|O|5}}, found in the Balsam apple vine (Momordica balsamina). It is a cucurbitane-type triterpenoid, related to cucurbitacin, isolated by C. Ramalhete and others in 2009.{{Cite journal |author1=Cátia Ramalhete |author2=Tayyab A. Mansoor |author3=Silva Mulhovo |author4=Joseph Molnár |author5=Maria-José U. Ferreira |name-list-style=amp | year = 2009 | title = Cucurbitane-Type Triterpenoids from the African Plant Momordica balsamina | journal = Journal of Natural Products | pmid = 19795842 | volume = 72 | issue = 11 | pages = 2009–2013 | doi = 10.1021/np900457u| hdl = 10884/1322 | hdl-access = free }}

Balsaminepentaol is an amorphous powder soluble in methanol and ethyl acetate but insoluble in n-hexane. It is cytotoxic at about 50 μM.

See also

References