:Beryllium sulfate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 486406740

| ImageFile = Beryllium sulfate.svg

| Name = Beryllium sulfate

| ImageFile1 = Beryllium sulfate 4 hydrate.jpg

| OtherNames =

| Section1 = {{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 24291

| InChI = 1/Be.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2

| SMILES = [Be+2].[O-]S([O-])(=O)=O

| SMILES_Comment = anhydrous

| SMILES1 = [OH2+][Be-2]([OH2+])([OH2+])[OH2+].[O-]S([O-])(=O)=O

| SMILES1_Comment = tetrahydrate

| InChIKey = KQHXBDOEECKORE-NUQVWONBAA

| CASNo = 13510-49-1

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo1_Ref = {{cascite|correct|CAS}}

| CASNo1 = 7787-56-6

| CASNo1_Comment = (tetrahydrate)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 01UQ1KPC7E

| UNII1_Ref = {{fdacite|correct|FDA}}

| UNII1 = 2TYK3LF8ZN

| UNII1_Comment = (tetrahydrate)

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 53473

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/Be.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = KQHXBDOEECKORE-UHFFFAOYSA-L

| PubChem = 26077

| EINECS = 236-842-2

| RTECS = DS4800000

}}

| Section2 = {{Chembox Properties

| Properties_ref = {{RubberBible62nd|page=B-82}}.

| Formula = BeSO₄

| MolarMass = 105.075 g/mol (anhydrous)
177.136 g/mol (tetrahydrate)

| Appearance = white solid

| Odor = odorless

| Density = 2.44 g/cm³ (anhydrous)
1.71 g/cm³ (tetrahydrate)

| Solubility = 36.2 g/100 mL (0 °C)
40.0 g/100 mL (20 °C)
54.3 g/100 mL (60 °C)

| SolubleOther = insoluble in alcohol

| MeltingPtC = 110

| MeltingPt_notes = (tetrahydrate, −2H₂O)
400 °C (dihydrate, dehydr.)
550–600 decomposes

| BoilingPtC = 2500

| BoilingPt_notes = (anhydrate)
580 °C (tetrahydrate)

| RefractIndex = 1.4374 (tetrahydrate)

}}

| Section5 = {{Chembox Thermochemistry

| DeltaHf = −1197 kJ/mol

| DeltaGf = −1088 kJ/mol

| Entropy = 90 J/mol K

}}

| Section7 = {{Chembox Hazards

| ExternalSDS = [http://www.inchem.org/documents/icsc/icsc/eics1351.htm ICSC 1351]

| GHSPictograms = {{GHS06|Acute Tox. 2}} {{GHS08|Carc. 1B}} {{GHS09|Aquatic Chronic 2}}

| GHSSignalWord = DANGER

| HPhrases = {{H-phrases|350|330|301|372|319|335|315|317|411}}

| FlashPt = Non-flammable

| LD50 = 82 mg/kg (rat, oral)
80 mg/kg (mouse, oral){{IDLH|7440417|Beryllium compounds (as Be)}}

| REL = Ca C 0.0005 mg/m³ (as Be){{PGCH|0054}}

| PEL = TWA 0.002 mg/m³
C 0.005 mg/m³ (30 minutes), with a maximum peak of 0.025 mg/m³ (as Be)

| IDLH = Ca [4 mg/m³ (as Be)]

}}

| Section8 = {{Chembox Related

| OtherAnions =

| OtherCations = Magnesium sulfate
Calcium sulfate
Strontium sulfate
Barium sulfate

}}

}}

Beryllium sulfate normally encountered as the tetrahydrate, [Be(H₂O)₄]SO₄ is a white crystalline solid. It was first isolated in 1815 by Jons Jakob Berzelius.{{citation | first = Charles | last = Lathrop Parsons | year = 1909 | title = The Chemistry and Literature of Beryllium | url = https://books.google.com/books?id=iI8vpmK7jgoC | location = London | pages = 29–33| isbn = 9780559264160 }}. Beryllium sulfate may be prepared by treating an aqueous solution of many beryllium salts with sulfuric acid, followed by evaporation of the solution and crystallization. The hydrated product may be converted to anhydrous salt by heating at 400 °C.{{citation | first = Pradyot | last = Patnaik | title = Handbook of Inorganic Chemicals | publisher = McGraw-Hill | year = 2002 | isbn = 0-07-049439-8}}.