:Buprenorphine-3-glucuronide
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = (5α,6β,14β,18R)-17-(Cyclopropylmethyl)-18-[(2S)-2-hydroxy-3,3-dimethyl-2-butanyl]-6-methoxy-18,19-dihydro-4,5-epoxy-6,14-ethenomorphinan-2-yl β-D-glucopyranosiduronic acid
| image = Buprenorphine-3-glucuronide.svg
| image_class = skin-invert-image
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 101224-22-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = L7FYM9GI97
| ATC_prefix = None
| ATC_suffix =
| PubChem = 127780
| DrugBank =
| ChemSpiderID = 113341
| chemical_formula =
| C=35 | H=49 | N=1 | O=10
| SMILES = C[C@]([C@H]1C[C@@]23CC[C@@]1([C@H]4[C@@]25CCN([C@@H]3Cc6c5c(c(cc6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)C(=O)O)O)O)O)O4)CC8CC8)OC)(C(C)(C)C)O
| StdInChI = 1S/C35H49NO10/c1-31(2,3)32(4,42)20-15-33-10-11-35(20,43-5)30-34(33)12-13-36(16-17-6-7-17)21(33)14-18-8-9-19(26(46-30)22(18)34)44-29-25(39)23(37)24(38)27(45-29)28(40)41/h8-9,17,20-21,23-25,27,29-30,37-39,42H,6-7,10-16H2,1-5H3,(H,40,41)/t20-,21-,23+,24+,25-,27+,29-,30-,32+,33-,34+,35-/m1/s1
| StdInChIKey = CZULHKGIAJASAA-WWIHBJMFSA-N
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category=
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
}}
Buprenorphine-3-glucuronide (B3G) is a major active metabolite of the opioid modulator buprenorphine.{{cite journal |vauthors=Brown SM, Holtzman M, Kim T, Kharasch ED | title = Buprenorphine metabolites, buprenorphine-3-glucuronide and norbuprenorphine-3-glucuronide, are biologically active | journal = Anesthesiology | volume = 115 | issue = 6 | pages = 1251–60 |date=December 2011 | pmid = 22037640 | pmc = 3560935 | doi = 10.1097/ALN.0b013e318238fea0 }} It has affinity for the μ-opioid receptor (Ki = 4.9 (± 2.7) pM), δ-opioid receptor (Ki = 270 nM), and nociceptin receptor (Ki = 36 μM), but not for the κ-opioid receptor. Whether B3G acts as an agonist or antagonist of each of the former three respective sites has yet to be determined.{{cite journal |vauthors=Brown SM, Campbell SD, Crafford A, Regina KJ, Holtzman MJ, Kharasch ED | title = P-glycoprotein is a major determinant of norbuprenorphine brain exposure and antinociception | journal = J. Pharmacol. Exp. Ther. | volume = 343 | issue = 1 | pages = 53–61 |date=October 2012 | pmid = 22739506 | pmc = 3464040 | doi = 10.1124/jpet.112.193433 }} In rats, at the doses assayed, B3G has been found to produce a small degree of antinociception, and similarly to buprenorphine in these assays, has not been found to produce sedation, reduce locomotion, or decrease respiratory rate. Of all of the active metabolites of buprenorphine, B3G is thought to be the most similar to the parent drug. Unlike norbuprenorphine, but similarly to buprenorphine (and norbuprenorphine-3-glucuronide), B3G is not a substrate for P-glycoprotein, and hence may cross the blood-brain-barrier significantly.