:Cadmium nitrate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 413213491

| ImageFile = cadmium nitrate.png

| ImageSize = 160px

| ImageName = Skeletal formula of cadmium chloride

| ImageFile1 = Dusičnan kademnatý.JPG

| ImageSize1 = 200px

| ImageName1 = Crystal of cadmium chloride

| IUPACName = Cadmium(II) nitrate

| OtherNames = Nitric acid, cadmium salt

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 23498

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 77732

| InChI = 1/Cd.2NO3/c;2*2-1(3)4/q+2;2*-1

| SMILES = [Cd+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O

| InChIKey = XIEPJMXMMWZAAV-UHFFFAOYAP

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/Cd.2NO3/c;2*2-1(3)4/q+2;2*-1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = XIEPJMXMMWZAAV-UHFFFAOYSA-N

| CASNo = 10325-94-7

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo1_Ref = {{cascite|correct|CAS}}

| CASNo1 = 10022-68-1

| CASNo1_Comment = (tetrahydrate)

| PubChem = 25154

| PubChem_Comment = (anhydrous)

| PubChem1 = 56924536

| PubChem1_Comment = (tetrahydrate)

| UNNumber = 3087, 2570

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = VF9RQV8VXV

| UNII1_Ref = {{fdacite|correct|FDA}}

| UNII1 = 4VEL5V5LC0

| UNII1_Comment = (tetrahydrate)

| EINECS = 233-710-6

}}

|Section2={{Chembox Properties

| Formula = Cd(NO₃)₂

| MolarMass = 236.42 g/mol (anhydrous)
308.48 g/mol (tetrahydrate)

| Appearance = White crystals, hygroscopic

| Odor = Odorless

| Density = 3.6 g/cm³ (anhydrous)
2.45 g/cm³ (tetrahdyrate)

| Solubility = 109.7 g/100 mL (0 °C)
126.6 g/100 mL (18 °C)
139.8 g/100 mL (30 °C)
320.9 g/100 mL (59.5 °C){{cite book|last1 = Seidell|first1 = Atherton|last2 = Linke|first2 = William F.|year = 1919|title = Solubilities of Inorganic and Organic Compounds|publisher = D. Van Nostrand Company|place = New York|edition = 2nd|page = 178}}

| SolubleOther = Soluble in acids, ammonia, alcohols, ether, acetone
5 g/L in methanol

| MeltingPtC = 360

| MeltingPt_notes =
at 760 mmHg (anhydrous)
{{convert|59.5|C|F K}}
at 760 mmHg (tetrahydrate){{CRC90}}

| BoilingPtC = 132

| BoilingPt_notes =
at 760 mmHg (tetrahydrate){{cite web|url = https://www.fishersci.ca/viewmsds.do?catNo=C13100|title = MSDS of Cadmium nitrate tetrahydrate|website = www.fishersci.ca|accessdate = 2014-06-25|publisher = Fisher Scientific}}

| MagSus = −5.51·10⁻⁵ cm³/mol (anhydrous)
−1.4·10⁻⁴ cm³/mol (tetrahydrate)

}}

|Section3={{Chembox Structure

| CrystalStruct = Cubic (anhydrous)
Orthorhombic (tetrahydrate)

| SpaceGroup = Fdd2, No. 43 (tetrahydrate){{Cite journal |doi= 10.1071/CH9781189 |title=Raman spectrum of cadmium nitrate |journal= Australian Journal of Chemistry |volume= 31 |issue = 6 |pages = 1189 |year = 1978 |last1 = James | first1 = D. W. | last2 = Carrick | first2 = M. T. | last3 = Leong | first3 = W. H. }}

| PointGroup = mm2 (tetrahydrate)

| LattConst_alpha = 90

| LattConst_beta = 90

| LattConst_gamma = 90

}}

|Section7={{Chembox Hazards

| GHSPictograms = {{GHS06}}{{GHS08}}{{GHS09}}{{Sigma-Aldrich|id=229520|name=Cadmium nitrate tetrahydrate|accessdate=2014-06-25}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|301|330|340|350|360|372|410}}

| PPhrases = {{P-phrases|201|260|273|284|301+310|310}}

| NFPA-H = 4

| NFPA-F = 0

| NFPA-R = 0

| NFPA-S = OX

| NFPA_ref = {{Sigma-Aldrich|id=229520|name=Cadmium nitrate tetrahydrate|accessdate=2014-06-25}}

| LD50 = 300 mg/kg (rats, oral)

| REL = Ca{{PGCH|0087}}

| PEL = [1910.1027] TWA 0.005 mg/m³ (as Cd)

| IDLH = Ca [9 mg/m³ (as Cd)]

}}

|Section8={{Chembox Related

| OtherAnions = Cadmium acetate
Cadmium chloride
Cadmium sulfate

| OtherCations = Zinc nitrate
Calcium nitrate
Magnesium nitrate

}}

}}

Cadmium nitrate describes any of the related members of a family of inorganic compounds with the general formula {{chem2|Cd(NO3)2*xH2O}}. The most commonly encountered form being the tetrahydrate.The anhydrous form is volatile, but the others are colourless crystalline solids that are deliquescent, tending to absorb enough moisture from the air to form an aqueous solution. Like other cadmium compounds, cadmium nitrate is known to be carcinogenic. According to X-ray crystallography, the tetrahydrate features octahedral Cd²⁺ centers bound to six oxygen ligands.{{cite journal |doi=10.1107/S0365110X66003773 |title=Refinement of the Structure of Cd(NO₃)₂.4H₂O |date=1966 |last1=Matković |first1=B. |last2=Ribar |first2=B. |last3=Zelenko |first3=B. |last4=Peterson |first4=S. W. |journal=Acta Crystallographica |volume=21 |issue=5 |pages=719–725 |bibcode=1966AcCry..21..719M }}