:Didesmethylcitalopram

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 451228130

| IUPAC_name = (RS or S)-1-[3-aminopropyl]-1-
(4-fluorophenyl)-1,3-dihydroisobenzofuran-5-carbonitrile

| image = Didesmethylescitalopram skeletal.svg

| image_class = skin-invert-image

| width =

| tradename =

| pregnancy_category =

| legal_status = uncontrolled

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life = 100 h

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 62498-69-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = ZE9YVI4ZEE

| ATC_prefix = none

| ATC_suffix =

| PubChem =

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 23935928

| smiles = c1cc(ccc1[C@]2(c3ccc(cc3CO2)C#N)CCCN)F

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C18H17FN2O/c19-16-5-3-15(4-6-16)18(8-1-9-20)17-7-2-13(11-21)10-14(17)12-22-18/h2-7,10H,1,8-9,12,20H2/t18-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = RKUKMUWCRLRPEJ-SFHVURJKSA-N

| C=18 | H= 17 | F= 1 | N= 2 | O= 1

}}

Didesmethylcitalopram is an active metabolite of the antidepressant drug citalopram (racemic).{{cite journal | vauthors = Rop PP, Durand A, Viala A, Jørgensen A | title = Simultaneous determination of citalopram, monodesmethylcitalopram and didesmethylcitalopram in plasma by high-performance liquid chromatography after column extraction | journal = Journal of Chromatography | volume = 527 | issue = 1 | pages = 226–32 | date = April 1990 | pmid = 2365786 | doi = 10.1016/s0378-4347(00)82105-2 }} Didesmethylescitalopram is an active metabolite of the antidepressant escitalopram, the S-enantiomer of citalopram. Like citalopram and escitalopram, didesmethyl(es)citalopram functions as a selective serotonin reuptake inhibitor (SSRI), and is responsible for some of its parents' therapeutic benefits.