:Difebarbamate

{{short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (5-ethyl-2,4,6-trioxo-5-phenyldihydropyrimidine-1,3(2H,4H)-diyl)bis-3-butoxypropane-1,2-diyl dicarbamate

| image = Difebarbamate.svg

| CAS_number = 15687-09-9

| ATC_prefix = None

| ATC_suffix =

| UNII = 7EE4K616KK

| PubChem = 71880

| ChEMBL = 2105563

| ChemSpiderID = 64896

| C = 28 | H = 42 | N = 4 | O = 9

| smiles = O=C1N(C(=O)N(C(=O)C1(c2ccccc2)CC)CC(OC(=O)N)COCCCC)CC(OC(=O)N)COCCCC

| StdInChI = 1S/C28H42N4O9/c1-4-7-14-38-18-21(40-25(29)35)16-31-23(33)28(6-3,20-12-10-9-11-13-20)24(34)32(27(31)37)17-22(41-26(30)36)19-39-15-8-5-2/h9-13,21-22H,4-8,14-19H2,1-3H3,(H2,29,35)(H2,30,36)

| StdInChIKey = GJJRIOLBUILIGK-UHFFFAOYSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category =

| legal_status =

| routes_of_administration = Oral

}}

Difebarbamate (INN) is a tranquilizer of the barbiturate and carbamate families which is used in Europe as a component of a combination drug formulation referred to as tetrabamate (Atrium, Sevrium).{{cite book | title = Index nominum 2000: international drug directory | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA333 | access-date = 26 November 2011 | year = 2000 | publisher = Taylor & Francis US | isbn = 978-3-88763-075-1 | page = 333}}{{cite web | url = http://whqlibdoc.who.int/hq/2004/WHO_EDM_QSM_2004.5.pdf | author = World Health Organization | title = The use of stems in the selection of International Nonproprietary Names (INN) for pharmaceutical substance | year = 2004 }}{{cite journal | vauthors = Vachta J, Valter K, Siegfried B | title = Metabolism of difebarbamate in man | journal = European Journal of Drug Metabolism and Pharmacokinetics | volume = 15 | issue = 3 | pages = 191–8 | date = 1990 | pmid = 2253648 | doi = 10.1007/BF03190203 | s2cid = 2916646 }}