:Dihydroactinidiolide
{{chembox
| verifiedrevid = 424059116
| Name = Dihydroactinidiolide
| ImageFile = Dihydroactinidiolide.png
| ImageSize = 160
| ImageAlt = Skeletal formula of dihydroactinidiolide
| ImageFile1 = Dihydroactinidiolide-3D-balls.png
| ImageSize1 = 180
| ImageAlt1 = Ball-and-stick model of the dihydroactinidiolide molecule
| PIN = (7aR)-4,4,7a-Trimethyl-5,6,7,7a-tetrahydro-1-benzofuran-2(4H)-one
| OtherNames = Dihydroactinidiolide
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4937432
| PubChem = 6432173
| InChI = 1/C11H16O2/c1-10(2)5-4-6-11(3)8(10)7-9(12)13-11/h7H,4-6H2,1-3H3/t11-/m1/s1
| InChIKey = IMKHDCBNRDRUEB-LLVKDONJBM
| SMILES1 = O=C\1O[C@]2(/C(=C/1)C(CCC2)(C)C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C11H16O2/c1-10(2)5-4-6-11(3)8(10)7-9(12)13-11/h7H,4-6H2,1-3H3/t11-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = IMKHDCBNRDRUEB-LLVKDONJSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 17092-92-1
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = O3M4862R3R
| SMILES = O=C2O[C@]1(C)CCCC(C)(C)C1=C2
}}
| Section2 = {{Chembox Properties
| Formula = C11H16O2
| MolarMass = 180.24 g/mol
| Density =
| MeltingPt =
| BoilingPt =
}}
}}
Dihydroactinidiolide is a volatile terpene. It has a sweet, tea-like odor and is used as a fragrance. Dihydroactinidiolide occurs naturally in black tea, fenugreek, fire ants, mangoes, and tobacco. It has also been prepared synthetically.S. Yao, M. Johannsen, R.G. Hazell, K.A. Jorgensen, J. Org. Chem., 63, 118-121.
Dihydroactinidiolide is a pheromone for a variety of insects;[http://www.pherobase.com/database/compound/compounds-detail-dihydroactinidiolide.php Pherobase listing for dihydroactinidiolide] for example, it is one of the three components of the pheromone for queen recognition of the workers of the red fire ant.Rocca, J.R. Tumlinson, J.H., Glancey, B.M., Lofgren, C.S., Tetrahedron Lett., 1983, 24, 1889.