:Dragomabin

{{Chembox

| ImageFile = Dragomabin.svg

| ImageSize = 250px

| ImageAlt =

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| index1_label = (originally proposed)

| index2_label = (revised)

| CASNo2 = 942039-60-3

| ChEBI1 = 65583

| ChEMBL1 = 391000

| PubChem1 = 16737469

| ChemSpiderID1 = 20568904

| SMILES2 = [C@@H](CC1=CC=CC=C1)(N(C([C@@H](CCCCC#C)C)=O)C)C(N[C@H](C(N([C@H](C(N([C@@H](CC2=CC=C(OC)C=C2)C(N)=O)C)=O)C)C)=O)C)=O

| InChI2 = 1S/C37H51N5O6/c1-9-10-11-13-16-25(2)35(45)42(7)32(24-28-17-14-12-15-18-28)34(44)39-26(3)36(46)40(5)27(4)37(47)41(6)31(33(38)43)23-29-19-21-30(48-8)22-20-29/h1,12,14-15,17-22,25-27,31-32H,10-11,13,16,23-24H2,2-8H3,(H2,38,43)(H,39,44)/t25-,26+,27+,31+,32+/m1/s1

| InChIKey2 = JAYHQHZOWYDLDQ-WLVJZVJWSA-N

}}

|Section2={{Chembox Properties

| C = 37 | H = 51 | N = 5 | O =6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Dragomabin is a lipopeptide isolated from the marine cyanobacteria Lyngbya majuscula.{{cite journal|last1=McPhail|first1=Kerry L.|last2=Correa|first2=Jhonny|last3=Linington|first3=Roger G.|last4=González|first4=José|last5=Ortega-Barría|first5=Eduardo|last6=Capson|first6=Todd L.|last7=Gerwick|first7=William H.|title=Antimalarial Linear Lipopeptides from a Panamanian Strain of the Marine Cyanobacterium|journal=Journal of Natural Products|date=June 2007|volume=70|issue=6|pages=984–988|doi=10.1021/np0700772|pmid=17441769|pmc=2745555}} It has in vitro antimalarial activity. In 2018, a laboratory synthesis of dragomabin was reported.{{cite journal | doi = 10.3390/md16090338 | doi-access = free | title = Total Synthesis of the Highly N-Methylated Peptides Carmabin a and Dragomabin | date = 2018 | last1 = Ye | first1 = Baijun | last2 = Jiang | first2 = Peng | last3 = Zhang | first3 = Tingrong | last4 = Sun | first4 = Yuanjun | last5 = Hao | first5 = Xin | last6 = Cui | first6 = Yingjun | last7 = Wang | first7 = Liang | last8 = Chen | first8 = Yue | journal = Marine Drugs | volume = 16 | issue = 9 | page = 338 | pmid = 30227592 | pmc = 6164609 }} The synthesis identified a misassignment of the configuration of the stereogenic center on the alkyne-bearing fragment and it was revised from (S) to (R).