:Ethyl methylphenylglycidate

{{chembox

| Watchedfields = changed

| verifiedrevid = 434802513

| Name = Ethyl methylphenylglycidate

| ImageFile = strawberry aldehyde.png

| ImageSize =

| ImageName =

| IUPACName = Ethyl 3-methyl-3-phenyloxirane-2-carboxylate

| OtherNames = Ethyl methylphenylglycidate
Strawberry aldehyde
Aldehyde C-16

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 77-83-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = UD51D5KR4A

| SMILES = CC(C2C(OCC)=O)(O2)C1=CC=CC=C1

| PubChem = 6501

| ChemSpiderID = 6255

| StdInChI = 1S/C12H14O3/c1-3-14-11(13)10-12(2,15-10)9-7-5-4-6-8-9/h4-8,10H,3H2,1-2H3

| StdInChIKey = LQKRYVGRPXFFAV-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| Appearance = Colourless liquid

| C=12|H=14|O=3

| Density = 1.09-1.10 g/cm3[http://chemicalland21.com/specialtychem/perchem/ETHYL%20METHYLPHENYLGLYCIDATE.htm Ethyl Methylphenylglycidate], chemicalland21.com

| MeltingPtC = 7 to 8

| MeltingPt_ref =

| BoilingPtC = 272 to 275

| BoilingPt_ref =

| Solubility = Insoluble

}}

}}

Ethyl methylphenylglycidate, commonly known as strawberry aldehyde, is an organic compound used in the flavor industry in artificial fruit flavors, in particular strawberry.{{cite book | title = Chemistry and technology of flavors and fragrances |author= David J. Rowe | year = 2005 | isbn = 0-8493-2372-X}}

Uses

Because of its pleasant taste and aroma, ethyl methylphenylglycidate finds use in the fragrance industry, in artificial flavors, and in cosmetics. Its end applications include perfumes, soaps, beauty care products, detergents, pharmaceuticals, baked goods, candies, ice cream, and others.

Chemistry

Ethyl methylphenylglycidate contains ester and epoxide functional groups, despite its common name, lacks presence of an aldehyde. It is a colourless liquid that is insoluble in water.

Ethyl methylphenylglycidate is usually prepared by the condensation of acetophenone and the ethyl ester of monochloroacetic acid in the presence of a base, in a reaction known as the Darzens condensation.

Safety

Long-term, high-dose studies in rats have demonstrated that ethyl methylphenylglycidate has no significant adverse health effects and is not carcinogenic.{{cite journal | pmid = 7327470 | doi = 10.1016/0015-6264(81)90522-8 | year = 1981 | last1 = Dunnington | first1 = D | last2 = Butterworth | first2 = MRS | last3 = Gaunt | first3 = IF | last4 = Mason | first4 = PL | last5 = Evans | first5 = JG | last6 = Gangolli | first6 = SD | title = Long-term toxicity study of ethyl methylphenylglycidate (strawberry aldehyde) in the rat. | volume = 19 | issue = 6 | pages = 691–9 | journal = Food and Cosmetics Toxicology}} The US Food and Drug Administration has classified ethyl methylphenylglycidate as generally recognized as safe (GRAS).{{cite web | url = https://www.fda.gov/food/foodingredientspackaging/foodadditives/foodadditivelistings/ucm091048.htm#ftnE | archive-url = https://web.archive.org/web/20090531233802/http://www.fda.gov/Food/FoodIngredientsPackaging/FoodAdditives/FoodAdditiveListings/ucm091048.htm#ftnE | url-status = dead | archive-date = May 31, 2009 | title = Food Additive Status List | publisher = Food and Drug Administration}}

See also

References