:Fumigaclavine A

{{Chembox

| ImageFile = Fumigaclavine A 2.svg

| ImageSize = 150px

| ImageAlt =

| IUPACName = [(6aR,9R,10S)-7,9-Dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-10-yl] acetate

| OtherNames = (8α,9β)-6,8-Dimethylergolin-9-ol acetate

|Section1={{Chembox Identifiers

| CASNo = 6879-59-0

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = DV9FK5AO1K

| ChEBI = 67159

| ChemSpiderID = 2299489

| KEGG = C20436

| PubChem = 3035188

| SMILES = C[C@@H]1CN([C@@H]2CC3=CNC4=CC=CC(=C34)C2[C@H]1OC(=O)C)C

| StdInChI=1S/C18H22N2O2/c1-10-9-20(3)15-7-12-8-19-14-6-4-5-13(16(12)14)17(15)18(10)22-11(2)21/h4-6,8,10,15,17-19H,7,9H2,1-3H3/t10-,15-,17-,18+/m1/s1

| StdInChIKey=GJSSYQDXZLZOLR-ONUGHKICSA-N

}}

|Section2={{Chembox Properties

| C=18 | H=22 | N=2 | O=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Fumigaclavine A is an antibacterial ergoline alkaloid produced by endophytic Aspergillus.{{cite journal | pmid = 23234304 | year = 2012 | last1 = Pinheiro | first1 = EA | last2 = Carvalho | first2 = JM | last3 = Dos Santos | first3 = DC | last4 = Feitosa | first4 = AD | last5 = Marinho | first5 = PS | last6 = Guilhon | first6 = GM | last7 = De Souza | first7 = AD | last8 = Da Silva | first8 = FM | last9 = Marinho | first9 = AM | title = Antibacterial activity of alkaloids produced by endophytic fungus Aspergillus sp. EJC08 isolated from medical plant Bauhinia guianensis | doi = 10.1080/14786419.2012.750316 | journal = Natural Product Research | volume = 27 | issue = 18 | pages = 1633–8 | s2cid = 38933742 }}

Both 8α and 8β diastereomers (epimers) were named fumigaclavine A in scientific literature.{{Cite journal| doi = 10.1039/C0NP00060D| pmid = 21186384| issn = 1460-4752| volume = 28| issue = 3| pages = 496–510| last1 = Wallwey| first1 = Christiane| last2 = Li| first2 = Shu-Ming| title = Ergot alkaloids: structure diversity, biosynthetic gene clusters and functional proof of biosynthetic genes| journal = Natural Product Reports| date = 2011-03-01}}