:Hydrangeic acid

{{Chembox

| ImageFile = Hydrangeic acid Structure.svg

| ImageSize = 250px

| ImageAlt = Chemical structure of hydrangeic acid

| PIN = 2-Hydroxy-6-[(E)-2-(4-hydroxyphenyl)ethen-1-yl]benzoic acid

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 491-79-2

| CASNo_Ref = {{Cascite|changed|PubChem}}

| ChEMBL = 248347

| ChemSpiderID = 4476740

| PubChem = 5318116

| UNII = GYE4WJ5J43

| SMILES = Oc2ccc(cc2)\C=C\c(c1C(O)=O)cccc1O

| InChI = 1/C15H12O4/c16-12-8-5-10(6-9-12)4-7-11-2-1-3-13(17)14(11)15(18)19/h1-9,16-17H,(H,18,19)/b7-4+

| InChIKey = UWXXIBUTKVUHTR-QPJJXVBHBH

| StdInChI = 1S/C15H12O4/c16-12-8-5-10(6-9-12)4-7-11-2-1-3-13(17)14(11)15(18)19/h1-9,16-17H,(H,18,19)/b7-4+

| StdInChIKey = UWXXIBUTKVUHTR-QPJJXVBHSA-N

}}

|Section2={{Chembox Properties

| C=15 | H=12 | O=4

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Hydrangeic acid is a stilbenoid found in the leaves of Hydrangea macrophylla.Hydrangeic acid from the processed leaves of Hydrangea macrophylla var. thunbergii as a new type of anti-diabetic compound. Hailong Zhang, Hisashi Matsuda, Chihiro Yamashita, Seikou Nakamura and Masayuki Yoshikawa, European Journal of Pharmacology, Volume 606, Issues 1–3, 15 March 2009, Pages 255–261, {{doi|10.1016/j.ejphar.2009.01.005}}

Hydrangeic acid is being investigated as a possible antidiabetic drug as it significantly lowered blood glucose, triglyceride and free fatty acid levels in laboratory animals.