:ICI-190,622
{{Short description|Anxiolytic drug}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 416568258
| IUPAC_name = 4-Amino-1-pent-3-ynyl-N-prop-2-enylpyrazolo[3,4-b]pyridine-5-carboxamide
| image = ICI-190,622.svg
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 103586-12-5
| ATC_prefix = None
| ATC_suffix =
| PubChem = 128415
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 113830
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = UC2UD08PKW
| ChEMBL = 88106
| C=15 | H=17 | N=5 | O=1
| smiles = CC#CCCN1C2=NC=C(C(=C2C=N1)N)C(=O)NCC=C
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C15H17N5O/c1-3-5-6-8-20-14-11(10-19-20)13(16)12(9-18-14)15(21)17-7-4-2/h4,9-10H,2,6-8H2,1H3,(H2,16,18)(H,17,21)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = ZPOHUNITDKKDQD-UHFFFAOYSA-N
}}
ICI-190,622 is an anxiolytic drug used in scientific research. It is a pyrazolopyridine derivative, related to other anxiolytic compounds such as tracazolate, and more distantly to zaleplon. It has similar effects to benzodiazepine drugs, but is structurally distinct and so is classed as a nonbenzodiazepine anxiolytic.{{cite journal |vauthors=Patel JB, Meiners BA, Salama AI, Malick JB, U'Prichard DC, Giles RE, Goldberg ME, Bare TM |title=Preclinical studies with pyrazolopyridine non-benzodiazepine anxiolytics: ICI 190,622 |journal=Pharmacology Biochemistry and Behavior |volume=29 |issue=4 |pages=775–9 |date=April 1988 |pmid=2901116 |doi= 10.1016/0091-3057(88)90205-5|s2cid=23893539 }}{{cite journal |vauthors=Bare TM, McLaren CD, Campbell JB, Firor JW, Resch JF, Walters CP, Salama AI, Meiners BA, Patel JB |title=Synthesis and structure-activity relationships of a series of anxioselective pyrazolopyridine ester and amide anxiolytic agents |journal=Journal of Medicinal Chemistry |volume=32 |issue=12 |pages=2561–73 |date=December 1989 |pmid=2573731 |doi= 10.1021/jm00132a011}}
See also
References
{{Reflist}}
{{Anxiolytics}}
{{GABAAR PAMs}}
Category:GABAA receptor positive allosteric modulators
{{Anxiolytic-stub}}
{{sedative-stub}}