:JZL184

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424696969

|ImageFile=jzl184_2structures.png

|ImageSize=

|PIN=4-Nitrophenyl 4-[di(2H-1,3-benzodioxol-5-yl)(hydroxy)methyl]piperidine-1-carboxylate

|OtherNames=

|Section1= {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=1101854-58-3

| PubChem=25021165

| UNII = 7MZ1I2J68A

| MeSHName=

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 21467840

| SMILES = c1cc(ccc1[N+](=O)[O-])OC(=O)N2CCC(CC2)C(c3ccc4c(c3)OCO4)(c5ccc6c(c5)OCO6)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C27H24N2O9/c30-26(38-21-5-3-20(4-6-21)29(32)33)28-11-9-17(10-12-28)27(31,18-1-7-22-24(13-18)36-15-34-22)19-2-8-23-25(14-19)37-16-35-23/h1-8,13-14,17,31H,9-12,15-16H2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = SEGYOKHGGFKMCX-UHFFFAOYSA-N

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 95015

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 576786

}}

|Section2= {{Chembox Properties

| Formula=C₂₇H₂₄N₂O₉

| MolarMass=520.15 g/mol

| Appearance=Pale yellow solid

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3= {{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt=

}}

}}

JZL184 is an irreversible inhibitor for monoacylglycerol lipase (MAGL), the primary enzyme responsible for degrading the endocannabinoid 2-arachidonoylglycerol (2-AG).{{cite journal |vauthors=Long JZ, Li W, Booker L, Burston JJ, Kinsey SG, Schlosburg JE, Pavón FJ, Serrano AM, Selley DE, Parsons LH, Lichtman AH, Cravatt BF | title = Selective blockade of 2-arachidonoylglycerol hydrolysis produces cannabinoid behavioral effects | journal = Nat. Chem. Biol. | volume = 5| issue = 1| pages = 37–44|date=November 2008 | pmid = 19029917 | doi = 10.1038/nchembio.129 | pmc = 2605181 }} It displays high selectivity for MAGL over other brain serine hydrolases, including the anandamide-degrading enzyme fatty acid amide hydrolase (FAAH), thereby making it a useful tool for studying the effects of endogenous 2-AG signaling, in vivo. Administration of JZL184 to mice was reported to cause dramatic elevation of brain 2-AG leading to several cannabinoid-related behavioral effects.