:Karavilagenin E

{{Chembox

| verifiedrevid = 444189863

| ImageFile = Karavilagenin E.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = (3S,5R,8S,9S,10S,13R,14S,17R)-17-((2R)-4-hydroxy-6-methylhept-5-en-2-yl)-4,4,13,14-tetramethyl-2,3,4,8,10,11,12,13,14,15,16,17-dodecahydro-1H-5,9-(epoxymethano)cyclopenta[a]phenanthren-3-ol

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 877603-72-0

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = RSQ68AYN9R

| PubChem = 66559251

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1078077

| SMILES = C[C@H](CC(O)/C=C(C)/C)[C@@]1([H])CC[C@@]2(C)[C@]3([H])C=C[C@]45C(C)(C)[C@@H](O)CC[C@@]4([H])[C@]3(CO5)CC[C@@]21C

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 24654295

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI=1S/C30H48O3/c1-19(2)16-21(31)17-20(3)22-10-12-28(7)23-11-13-30-24(8-9-25(32)26(30,4)5)29(23,18-33-30)15-14-27(22,28)6/h11,13,16,20-25,31-32H,8-10,12,14-15,17-18H2,1-7H3/t20-,21+,22-,23+,24+,25+,27-,28+,29+,30-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = BZKMSMPQWDQSDS-ZRBXTNFGSA-N

}}

|Section2={{Chembox Properties

| C=30 | H=48 | O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Karavilagenin E is a chemical compound found in the Balsam apple vine (Momordica balsamina). It is a cucurbitane-type triterpenoid, related to cucurbitacin.{{cite journal |author1=Cátia Ramalhete |author2=Tayyab A. Mansoor |author3=Silva Mulhovo |author4=Joseph Molnár |author5=Maria-José U. Ferreira | year = 2009 | pages = 2009–2013 | issue = 11 | title = Cucurbitane-Type Triterpenoids from the African Plant Momordica balsamina | volume = 72 | pmid = 19795842 | journal = Journal of Natural Products | doi = 10.1021/np900457u| hdl = 10884/1322 | hdl-access = free }}

Karavilagenin E is soluble in methanol and ethyl acetate but insoluble in n-hexane.