:Lariciresinol

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 405874929

| Name = Lariciresinol

| ImageFile = Lariciresinol.svg

| ImageName = Chemical structure of lariciresinol

| IUPACName = 4-[(2S,3R,4R)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(hydroxymethyl)oxolan-2-yl]-2-methoxyphenol

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 27003-73-2

| CASNo_Ref = {{cascite|correct|??}}

| CASNoOther =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 73XCE5OZB0

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C10646

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 518421

| PubChem = 332427

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 294521

| SMILES = COc1cc(ccc1O)C[C@H]2CO[C@@H]([C@H]2CO)c3ccc(c(c3)OC)O

| InChI = 1/C20H24O6/c1-24-18-8-12(3-5-16(18)22)7-14-11-26-20(15(14)10-21)13-4-6-17(23)19(9-13)25-2/h3-6,8-9,14-15,20-23H,7,10-11H2,1-2H3/t14-,15-,20+/m0/s1

| InChIKey = MHXCIKYXNYCMHY-AUSJPIAWBV

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C20H24O6/c1-24-18-8-12(3-5-16(18)22)7-14-11-26-20(15(14)10-21)13-4-6-17(23)19(9-13)25-2/h3-6,8-9,14-15,20-23H,7,10-11H2,1-2H3/t14-,15-,20+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = MHXCIKYXNYCMHY-AUSJPIAWSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| Formula = C20H24O6

| MolarMass = 360.40 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

}}

Lariciresinol is a lignan, i.e., a type of phenylpropanoids. It is the precursor to enterolignans by the action of gut microflora. Enterolignans are of interest because they are speculated{{by whom|date=January 2025}} to exhibit beneficial medicinal properties.{{which|date=January 2025}}{{cn|date=January 2025}}

Occurrence

In food, it is found in sesame seeds and in Brassica vegetables.{{Cite journal | doi = 10.1079/BJN20051371| pmid = 15877880| title = Lignan contents of Dutch plant foods: A database including lariciresinol, pinoresinol, secoisolariciresinol and matairesinol| journal = British Journal of Nutrition| volume = 93| issue = 3| pages = 393–402| year = 2007| last1 = Milder| first1 = Ivon E. J| last2 = Arts| first2 = Ilja C. W| last3 = Putte| first3 = Betty van de| last4 = Venema| first4 = Dini P| last5 = Hollman| first5 = Peter C. H| doi-access = free}} It is also found in the bark and wood of white fir (Abies alba).{{Cite journal | doi = 10.1016/j.indcrop.2013.10.005| title = Chemical composition of the silver fir (Abies alba) bark extract Abigenol® and its antioxidant activity| journal = Industrial Crops and Products| volume = 52| pages = 23–28| year = 2014| last1 = Benković| first1 = Eva Tavčar| last2 = Grohar| first2 = Tina| last3 = Žigon| first3 = Dušan| last4 = Švajger| first4 = Urban| last5 = Janeš| first5 = Damjan| last6 = Kreft| first6 = Samo| last7 = Štrukelj| first7 = Borut}}

See also

References