:Liquiritigenin

{{Chembox

| ImageFile = Liquiritigenin.svg

| ImageClass = skin-invert-image

| ImageSize = 200px

| IUPACName = (2S)-4′,7-Dihydroxyflavan-4-one

| SystematicName = (2S)-7-Hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-1-benzopyran-4-one

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 578-86-9

| CASNo_Ref = {{cascite|correct|}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = T194LKP9W6

| PubChem = 114829

| KEGG = C09762

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 28777

| ChEMBL = 252642

| ChemSpiderID = 102790

| SMILES = O=C2c3c(O[C@H](c1ccc(O)cc1)C2)cc(O)cc3

| InChI = 1/C15H12O4/c16-10-3-1-9(2-4-10)14-8-13(18)12-6-5-11(17)7-15(12)19-14/h1-7,14,16-17H,8H2/t14-/m0/s1

| InChIKey = FURUXTVZLHCCNA-AWEZNQCLBC

| StdInChI = 1S/C15H12O4/c16-10-3-1-9(2-4-10)14-8-13(18)12-6-5-11(17)7-15(12)19-14/h1-7,14,16-17H,8H2/t14-/m0/s1

| StdInChIKey = FURUXTVZLHCCNA-AWEZNQCLSA-N

}}

|Section2={{Chembox Properties

| C=15 | H=12 | O=4

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Liquiritigenin is a flavanone that was isolated from Glycyrrhiza uralensis, and is found in a variety of plants of the Glycyrrhiza genus, including Glycyrrhiza glabra (licorice).{{cite journal | pmid = 19074639 | year = 2009 | last1 = Kim | first1 = YW | last2 = Kang | first2 = HE | last3 = Lee | first3 = MG | last4 = Hwang | first4 = SJ | last5 = Kim | first5 = SC | last6 = Lee | first6 = CH | last7 = Kim | first7 = SG | title = Liquiritigenin, a flavonoid aglycone from licorice, has a choleretic effect and the ability to induce hepatic transporters and phase-II enzymes | volume = 296 | issue = 2 | pages = G372–81 | doi = 10.1152/ajpgi.90524.2008 | journal = American Journal of Physiology. Gastrointestinal and Liver Physiology}} It is an estrogenic compound which acts as a selective agonist of the ERβ subtype of the estrogen receptor (ER),{{cite journal | doi = 10.1016/j.mce.2007.11.020 | title = Liquiritigenin is a plant-derived highly selective estrogen receptor β agonist | year = 2008 | last1 = Mersereau | first1 = Jennifer E. | last2 = Levy | first2 = Nitzan | last3 = Staub | first3 = Richard E. | last4 = Baggett | first4 = Scott | last5 = Zogric | first5 = Tetjana | last6 = Chow | first6 = Sylvia | last7 = Ricke | first7 = William A. | last8 = Tagliaferri | first8 = Mary | last9 = Cohen | first9 = Isaac | last10 = Bjeldanes | first10 = Leonard F. | last11 = Leitman | first11 = D. C. | journal = Molecular and Cellular Endocrinology | volume = 283 | pages = 49–57 | pmid = 18177995 | issue = 1–2 | pmc = 2277338| display-authors = 8 }} though it is also reported to act as an ERα partial agonist at sufficient concentrations.{{Citation | last = Green | first = Sarah E | title = In Vitro Comparison of Estrogenic Activities of Popular Women's Health Botanicals | year = 2015 | url = https://indigo.uic.edu/handle/10027/19647 | access-date = 2016-01-01 | archive-url = https://web.archive.org/web/20160222183517/https://indigo.uic.edu/handle/10027/19647 | archive-date = 2016-02-22 | url-status = dead }} It also has a choleretic effect.

Liquiritigenin,NADPH:oxygen oxidoreductase (hydroxylating, aryl migration) is an enzyme that uses liquiritigenin, O₂, NADPH and H⁺ to produce 2,7,4'-trihydroxyisoflavanone, H₂O, and NADP⁺.