:Lufuradom

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| IUPAC_name = N-[(8-fluoro-1-methyl-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-yl)methyl]-3-furamide

| image = Lufuradom.svg

| CAS_number = 85118-42-9

| CAS_supplemental =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = GS8D070P7W

| ATC_prefix = None

| ATC_suffix =

| PubChem = 3045400

| ChemSpiderID = 2308141

| C = 22 | H = 20 | F = 1 | N = 3 | O = 2

| smiles = O=C(C1=COC=C1)NCC2N(C)C3=C(C(C4=CC=CC=C4)=NC2)C=CC(F)=C3

| StdInChI = 1S/C22H20FN3O2/c1-26-18(13-25-22(27)16-9-10-28-14-16)12-24-21(15-5-3-2-4-6-15)19-8-7-17(23)11-20(19)26/h2-11,14,18H,12-13H2,1H3,(H,25,27)

| StdInChIKey = QJSCDZOUCFWCKD-UHFFFAOYSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category =

| legal_status =

| routes_of_administration =

}}

Lufuradom (INN) is a drug and benzodiazepine derivative which, unlike other benzodiazepines, is described as an analgesic.{{cite book | author = World Health Organization | title = International nonproprietary names (INN) for pharmaceutical substances, 1988: lists 1-58 of proposed INN and lists 1-27 of recommended INN : cumulative list | url = https://books.google.com/books?id=eMUjAQAAMAAJ&pg=PA252 | access-date = 26 April 2012 | date = 31 December 1988 | publisher = World Health Organization | isbn = 978-92-4-056014-7 | page = 252}}{{cite web | vauthors = Cooke J | date = 17 January 2024 | title = List of Benzodiazepines: DBZDs & Rx Medications | url = https://tripsitter.com/benzodiazepines/ | work = Tripsetter }} Similarly to its analogue tifluadom, it was never marketed.