tifluadom
{{Short description|Pair of enantiomers}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 461743259
| IUPAC_name = N-
| image = Tifluadom.svg
| width = 222
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = unknown
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 83386-35-0
| ATC_prefix = none
| ATC_suffix =
| PubChem = 115208
| IUPHAR_ligand = 1667
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 103084
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = TF8X866L0I
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D02694
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 169703
| C=22 | H=20 | F=1 | N=3 | O=1 | S=1
| smiles = O=C(NCC1N(c3ccccc3C(=N/C1)\c2ccccc2F)C)c4ccsc4
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H20FN3OS/c1-26-16(13-25-22(27)15-10-11-28-14-15)12-24-21(17-6-2-4-8-19(17)23)18-7-3-5-9-20(18)26/h2-11,14,16H,12-13H2,1H3,(H,25,27)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NPGABYHTDVGGJK-UHFFFAOYSA-N
| melting_point =
| melting_high =
}}
Tifluadom is a benzodiazepine derivative with an unusual activity profile.{{cite patent | country = US | number = 4325957 | title = 2-Acylaminomethyl-1,4-benzodiazepine derivatives and their salts and pharmaceutical compositions thereof | assign1 = Abbott Products GmbH | inventor = Zeugner H, Roemer D, Liepmann H, Milkowski W | gdate = 20 April 1982 }} Unlike most benzodiazepines, tifluadom has no activity at the GABAA receptor, but instead is a selective agonist for the κ-opioid receptor.{{cite journal | vauthors = Römer D, Büscher HH, Hill RC, Maurer R, Petcher TJ, Zeugner H, Benson W, Finner E, Milkowski W, Thies PW | title = Unexpected opioid activity in a known class of drug | journal = Life Sciences | volume = 31 | issue = 12–13 | pages = 1217–20 | date = 1982 | pmid = 6292610 | doi = 10.1016/0024-3205(82)90346-0 }} It has potent analgesic{{cite journal | vauthors = Genovese RF, Dykstra LA | title = Tifluadom's effects under electric shock titration and tail-immersion procedures in squirrel monkeys | journal = Life Sciences | volume = 39 | issue = 19 | pages = 1713–9 | date = November 1986 | pmid = 3773641 | doi = 10.1016/0024-3205(86)90089-5 }} and diuretic{{cite journal | vauthors = Leander JD | title = Kappa opioid agonists and antagonists: effects on drinking and urinary output | journal = Appetite | volume = 5 | issue = 1 | pages = 7–14 | date = March 1984 | pmid = 6091543 | doi = 10.1016/s0195-6663(84)80044-6 | s2cid = 31380360 }} effects in animals, and also has sedative effects and stimulates appetite.{{cite journal | vauthors = Jackson HC, Sewell RD | title = The role of opioid receptor sub-types in tifluadom-induced feeding | journal = The Journal of Pharmacy and Pharmacology | volume = 36 | issue = 10 | pages = 683–6 | date = October 1984 | pmid = 6150086 | doi = 10.1111/j.2042-7158.1984.tb04843.x | s2cid = 13046110 }}{{cite journal | vauthors = Dykstra LA, Gmerek DE, Winger GA, Woods JH | title = Kappa opioids in rhesus monkeys. I. Diuresis, sedation, analgesia and discriminative stimulus effects. | journal = Journal of Pharmacology and Experimental Therapeutics | date = August 1987 | volume = 242 | issue = 2 | pages = 413–20 | pmid = 3612543 | url = http://jpet.aspetjournals.org/content/242/2/413.short }}
While tifluadom has several effects which might have potential uses in medicine, such as analgesia and appetite stimulation, κ-opioid agonists tend to produce undesirable effects in humans such as dysphoria and hallucinations, and so these drugs tend to only be used in scientific research. Dysphoric effects are similar to those seen when using other κ-opioid receptor agonists like pentazocine and salvinorin A, and can be considered the opposite of morphine-induced euphoria. As such, kappa agonists are believed to have very limited abuse potential.
See also
- Lufuradom
- GYKI-52895, a benzodiazepine which is a dopamine reuptake inhibitor without GABAergic function
- GYKI-52,466, a benzodiazepine which is an AMPAkine and glutamate antagonist without GABAergic function
References
{{Reflist|2}}
{{Hallucinogens}}
{{Opioidergics}}
{{Benzodiazepines}}
Category:Kappa-opioid receptor agonists