:Procymidone

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 417479908

| ImageFile = Procymidone.svg

| ImageSize =

| IUPACName = 3-(3,5-dichlorophenyl)-1,5-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 32809-16-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = EC2FI67U2Y

| PubChem = 36242

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 513678

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C10986

| SMILES = Clc1cc(cc(Cl)c1)N2C(=O)C3(C)CC3(C)C2=O

| ChemSpiderID = 33326

| StdInChI = 1S/C13H11Cl2NO2/c1-12-6-13(12,2)11(18)16(10(12)17)9-4-7(14)3-8(15)5-9/h3-5H,6H2,1-2H3

| StdInChIKey = QXJKBPAVAHBARF-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=13 | H=11 | Cl=2 | N=1 | O=2

| MolarMass = 284.138 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Procymidone is a pesticide. It is often used for killing unwanted ferns and nettles, and as a dicarboximide fungicide for killing fungi, for example as seed dressing, pre-harvest spray or post-harvest dip of lupins, grapes, stone fruit, strawberries.{{cite web|last=Australian Pesticides and Veterinary Medicine Authority|title=Chemical Review Program/Procymidone|url=http://www.apvma.gov.au/products/review/current/procymidone.php|access-date=9 February 2012|archive-url=https://web.archive.org/web/20120126165201/http://www.apvma.gov.au/products/review/current/procymidone.php|archive-date=26 January 2012|url-status=dead}} It is a known endocrine disruptor (androgen receptor antagonist){{Citation needed|date=December 2019|reason=removed citation to predatory publisher content}} which interferes with the sexual differentiation of male rats.{{cite journal|vauthors=Ostby J, Kelce WR, Lambright C, Wolf CJ, Mann P, Gray LE |title=The fungicide procymidone alters sexual differentiation in the male rat by acting as an androgen-receptor antagonist in vivo and in vitro|journal=Toxicol Ind Health|year=1999|volume=15|issue=1–2|pages=80–93|pmid=10188193|doi=10.1191/074823399678846718}} It is considered to be a poison.{{cite web|last=Australian Pesticides and Veterinary Medicine Authority, Chemical Review Program|title=procymidone_poster.pdf|url=http://www.apvma.gov.au/products/review/docs/procymidone_poster.pdf|access-date=9 February 2012|archive-url=https://web.archive.org/web/20120227172545/http://www.apvma.gov.au/products/review/docs/procymidone_poster.pdf|archive-date=27 February 2012|url-status=dead}}