:Pterocarpin

{{refimprove|date=June 2023}}

{{Chembox

| ImageFile = Pterocarpin.svg

| ImageSize = 250px

| ImageAlt = Chemical structure of pterocarpin

| IUPACName =

| OtherNames = (−)-Pterocarpin
3-Methoxy-8,9-methylenedioxypterocarpan

|Section1={{Chembox Identifiers

| CASNo = 524-97-0

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = NZ7T2XO0S1

| PubChem = 454895

| SMILES = O(C)C=1C=C2C([C@]3([C@](C=4C(O3)=CC5=C(C4)OCO5)(CO2)[H])[H])=CC1

}}

|Section2={{Chembox Properties

| C = 17 | H = 14 | O = 5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Pterocarpin is a pterocarpan found in the Fabaceae species Baphia nitida, Ononis viscosa subsp. breviflora, Pterocarpus spp., Sophora angustifolia, Sophora substrata and Swartzia madagascariensis.{{Cite web |url=http://kanaya.naist.jp/knapsack_jsp/information.jsp?mode=r&word=C00009616&key=5 |title=Pterocarpin at knapsack_jsp |access-date=2013-02-05 |archive-url=https://web.archive.org/web/20140222201449/http://kanaya.naist.jp/knapsack_jsp/information.jsp?mode=r&word=C00009616&key=5 |archive-date=2014-02-22 |url-status=dead }}